Difference between revisions of "LEUCOPELARGONIDIN-CMPD"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_4815 == * Synonym(s): == Reactions associated == * ADENOSINETRIPHOSPHATASE-RXN ** pantograph-esiliculosus == Pathways associat...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEUCOPELARGONIDIN-CMPD LEUCOPELARGONIDIN-CMPD] == * smiles: ** C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEUCOPELARGONIDIN-CMPD LEUCOPELARGONIDIN-CMPD] == |
+ | * smiles: | ||
+ | ** C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O)O)))=CC=C(C=3)O) | ||
+ | * common name: | ||
+ | ** (2R,3S,4S)-leucopelargonidin | ||
+ | * inchi key: | ||
+ | ** InChIKey=FSVMLWOLZHGCQX-SOUVJXGZSA-N | ||
+ | * molecular weight: | ||
+ | ** 290.272 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** cis-3,4-leucopelargonidin | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[LEUCPEL-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]] |
+ | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3286789 3286789] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.2535665.html 2535665] | ||
+ | * HMDB : HMDB32322 | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17343 17343] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C03648 C03648] | ||
+ | {{#set: smiles=C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O)O)))=CC=C(C=3)O)}} | ||
+ | {{#set: common name=(2R,3S,4S)-leucopelargonidin}} | ||
+ | {{#set: inchi key=InChIKey=FSVMLWOLZHGCQX-SOUVJXGZSA-N}} | ||
+ | {{#set: molecular weight=290.272 }} | ||
+ | {{#set: common name=cis-3,4-leucopelargonidin}} | ||
+ | {{#set: consumed by=LEUCPEL-RXN}} | ||
+ | {{#set: produced by=DIHYDROKAEMPFEROL-4-REDUCTASE-RXN}} |
Latest revision as of 19:07, 21 March 2018
Contents
Metabolite LEUCOPELARGONIDIN-CMPD
- smiles:
- C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O)O)))=CC=C(C=3)O)
- common name:
- (2R,3S,4S)-leucopelargonidin
- inchi key:
- InChIKey=FSVMLWOLZHGCQX-SOUVJXGZSA-N
- molecular weight:
- 290.272
- Synonym(s):
- cis-3,4-leucopelargonidin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links