Difference between revisions of "CPD-786"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HOMOGENTISATE-12-DIOXYGENASE-RXN HOMOGENTISATE-12-DIOXYGENASE-RXN] == * direction: ** LEFT-TO-RIGHT...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-786 CPD-786] == * smiles: ** C(CCC=CC(C([O-])=O)=O)([O-])=O * common name: ** (4Z)-2-oxohep...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-786 CPD-786] == |
− | * | + | * smiles: |
− | ** | + | ** C(CCC=CC(C([O-])=O)=O)([O-])=O |
* common name: | * common name: | ||
− | ** | + | ** (4Z)-2-oxohept-4-enedioate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=HYVSZVZMTYIHKF-IWQZZHSRSA-L |
+ | * molecular weight: | ||
+ | ** 170.121 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** OHED | ||
+ | ** 2-oxo-hept-3-ene-1,7-dioate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN1K-87]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9543150 9543150] |
− | * | + | * CHEMSPIDER: |
− | ** [http://www. | + | ** [http://www.chemspider.com/Chemical-Structure.4573699.html 4573699] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17205 17205] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03063 C03063] |
− | + | {{#set: smiles=C(CCC=CC(C([O-])=O)=O)([O-])=O}} | |
− | {{#set: | + | {{#set: common name=(4Z)-2-oxohept-4-enedioate}} |
− | + | {{#set: inchi key=InChIKey=HYVSZVZMTYIHKF-IWQZZHSRSA-L}} | |
− | {{#set: | + | {{#set: molecular weight=170.121 }} |
− | {{#set: | + | {{#set: common name=OHED|2-oxo-hept-3-ene-1,7-dioate}} |
− | {{#set: | + | {{#set: produced by=RXN1K-87}} |
Latest revision as of 19:07, 21 March 2018
Contents
Metabolite CPD-786
- smiles:
- C(CCC=CC(C([O-])=O)=O)([O-])=O
- common name:
- (4Z)-2-oxohept-4-enedioate
- inchi key:
- InChIKey=HYVSZVZMTYIHKF-IWQZZHSRSA-L
- molecular weight:
- 170.121
- Synonym(s):
- OHED
- 2-oxo-hept-3-ene-1,7-dioate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CCC=CC(C([O-])=O)=O)([O-])=O" cannot be used as a page name in this wiki.