Difference between revisions of "PWY-2541"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-D-GALACTOSE ALPHA-D-GALACTOSE] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * inchi key: **...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2541 PWY-2541] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-33...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2541 PWY-2541] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-3398] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** plant sterol biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | == Reaction(s) | + | '''10''' reactions found over '''36''' reactions in the full pathway |
− | * [[RXN- | + | * [[1.14.13.70-RXN]] |
− | * [[RXN- | + | ** 1 associated gene(s): |
− | * [[RXN- | + | *** [[Tiso_gene_8263]] |
− | * [[RXN- | + | ** 1 reconstruction source(s) associated: |
− | == | + | *** [[orthology-esiliculosus]] |
− | * [[ | + | * [[2.1.1.143-RXN]] |
− | * [[ | + | ** 2 associated gene(s): |
+ | *** [[Tiso_gene_11850]] | ||
+ | *** [[Tiso_gene_11849]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[CYCLOARTENOL-SYNTHASE-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_14526]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[CYCLOEUCALENOL-CYCLOISOMERASE-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_10532]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-4021]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Tiso_gene_11849]] | ||
+ | *** [[Tiso_gene_11850]] | ||
+ | *** [[Tiso_gene_12590]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | * [[RXN-4144]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_10982]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-4209]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_5446]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | * [[RXN-4210]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_8982]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-707]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_8982]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN3O-218]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_5446]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=PWY-5670 PWY-5670] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=PWY-5670 PWY-5670] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11925 RXN-11925] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11926 RXN-11926] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11927 RXN-11927] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11928 RXN-11928] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11929 RXN-11929] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11930 RXN-11930] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11931 RXN-11931] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11932 RXN-11932] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11933 RXN-11933] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11934 RXN-11934] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11935 RXN-11935] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11936 RXN-11936] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11937 RXN-11937] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11938 RXN-11938] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11939 RXN-11939] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-4161 RXN-4161] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-4221 RXN-4221] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-4222 RXN-4222] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-4224 RXN-4224] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-4242 RXN-4242] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-4243 RXN-4243] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-708 RXN-708] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8352 RXN-8352] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8353 RXN-8353] | ||
== External links == | == External links == | ||
− | * | + | * PLANTCYC : PWY-2541 |
− | * | + | * ARACYC: |
− | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-2541 PWY-2541] | |
− | + | {{#set: taxonomic range=TAX-3398}} | |
− | ** [http:// | + | {{#set: common name=plant sterol biosynthesis}} |
− | + | {{#set: reaction found=10}} | |
− | + | {{#set: total reaction=36}} | |
− | + | {{#set: completion rate=28.0}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:06, 21 March 2018
Pathway PWY-2541
- taxonomic range:
- common name:
- plant sterol biosynthesis
- Synonym(s):
Reaction(s) found
10 reactions found over 36 reactions in the full pathway
- 1.14.13.70-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- 2.1.1.143-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- CYCLOARTENOL-SYNTHASE-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
- CYCLOEUCALENOL-CYCLOISOMERASE-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-4021
- 3 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-4144
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-4209
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-4210
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-707
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN3O-218
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
- PWY-5670
- PWY-5670
- RXN-11925
- RXN-11926
- RXN-11927
- RXN-11928
- RXN-11929
- RXN-11930
- RXN-11931
- RXN-11932
- RXN-11933
- RXN-11934
- RXN-11935
- RXN-11936
- RXN-11937
- RXN-11938
- RXN-11939
- RXN-4161
- RXN-4221
- RXN-4222
- RXN-4224
- RXN-4242
- RXN-4243
- RXN-708
- RXN-8352
- RXN-8353
External links
- PLANTCYC : PWY-2541
- ARACYC: