Difference between revisions of "CYSTINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17331 CPD-17331] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYSTINE CYSTINE] == * smiles: ** C(C(C(=O)[O-])[N+])SSCC(C([O-])=O)[N+] * common name: ** L-cys...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYSTINE CYSTINE] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(C(C(=O)[O-])[N+])SSCC(C([O-])=O)[N+] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** L-cystine |
+ | * inchi key: | ||
+ | ** InChIKey=LEVWYRKDKASIDU-IMJSIDKUSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 240.292 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-15128]] |
+ | * [[CYSTHIOCYS-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * CAS : 24645-67-8 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6992103 6992103] |
+ | * HMDB : HMDB00192 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01420 C01420] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35491 35491] |
− | {{#set: smiles= | + | * METABOLIGHTS : MTBLC35491 |
− | {{#set: | + | {{#set: smiles=C(C(C(=O)[O-])[N+])SSCC(C([O-])=O)[N+]}} |
− | {{#set: | + | {{#set: common name=L-cystine}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=LEVWYRKDKASIDU-IMJSIDKUSA-N}} |
− | + | {{#set: molecular weight=240.292 }} | |
− | {{#set: consumed by=RXN- | + | {{#set: consumed by=RXN-15128|CYSTHIOCYS-RXN}} |
− | + |
Latest revision as of 19:23, 21 March 2018
Contents
Metabolite CYSTINE
- smiles:
- C(C(C(=O)[O-])[N+])SSCC(C([O-])=O)[N+]
- common name:
- L-cystine
- inchi key:
- InChIKey=LEVWYRKDKASIDU-IMJSIDKUSA-N
- molecular weight:
- 240.292
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 24645-67-8
- PUBCHEM:
- HMDB : HMDB00192
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC35491
"C(C(C(=O)[O-])[N+])SSCC(C([O-])=O)[N+" cannot be used as a page name in this wiki.