Difference between revisions of "Dodecanoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15699 CPD-15699] == * smiles: ** [CH](=O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=PYMYPHUHKU...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Dodecanoyl-ACPs Dodecanoyl-ACPs] == * common name: ** a dodecanoyl-[acp] * Synonym(s): ** a dod...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15699 CPD-15699] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Dodecanoyl-ACPs Dodecanoyl-ACPs] ==
* smiles:
+
** [CH](=O)C(O)C(O)C(O)CO
+
* inchi key:
+
** InChIKey=PYMYPHUHKUWMLA-VAYJURFESA-N
+
 
* common name:
 
* common name:
** aldehydo-L-arabinose
+
** a dodecanoyl-[acp]
* molecular weight:
+
** 150.131   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a dodecanoyl-[acyl-carrier protein]
 +
** a lauryl-[acp]
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-9535]]
 +
* [[RXN-9653]]
 +
* [[3.1.2.21-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9534]]
 +
* [[RXN-9661]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-14102]]
 
* [[RXN-14808]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a dodecanoyl-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460291 5460291]
+
{{#set: common name=a dodecanoyl-[acyl-carrier protein]|a lauryl-[acp]}}
* CHEBI:
+
{{#set: consumed by=RXN-9535|RXN-9653|3.1.2.21-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6182 6182]
+
{{#set: produced by=RXN-9534|RXN-9661}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C11476 C11476]
+
{{#set: smiles=[CH](=O)C(O)C(O)C(O)CO}}
+
{{#set: inchi key=InChIKey=PYMYPHUHKUWMLA-VAYJURFESA-N}}
+
{{#set: common name=aldehydo-L-arabinose}}
+
{{#set: molecular weight=150.131    }}
+
{{#set: reversible reaction associated=RXN-14102|RXN-14808}}
+

Latest revision as of 19:07, 21 March 2018

Metabolite Dodecanoyl-ACPs

  • common name:
    • a dodecanoyl-[acp]
  • Synonym(s):
    • a dodecanoyl-[acyl-carrier protein]
    • a lauryl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a dodecanoyl-[acp" cannot be used as a page name in this wiki.
  • "a dodecanoyl-[acyl-carrier protein" cannot be used as a page name in this wiki.
  • "a lauryl-[acp" cannot be used as a page name in this wiki.