Difference between revisions of "PWY-7686"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] == * smiles: ** C(CC([N+])C(=O)[O-])ONC(=[N+])N * inchi key: ** InChIKey...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7686 PWY-7686] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-3...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7686 PWY-7686] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154] |
− | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | |
− | ** | + | |
* common name: | * common name: | ||
− | ** L- | + | ** L-malate degradation II |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** (S)--malate degradation II |
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''1''' reactions found over '''1''' reactions in the full pathway | |
− | * [[ | + | * [[1.1.1.39-RXN]] |
− | == Reaction(s) | + | ** 3 associated gene(s): |
+ | *** [[Tiso_gene_12896]] | ||
+ | *** [[Tiso_gene_6675]] | ||
+ | *** [[Tiso_gene_12200]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33154}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=L-malate degradation II}} | |
− | + | {{#set: common name=(S)--malate degradation II}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=1}} | |
− | + | {{#set: completion rate=100.0}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:07, 21 March 2018
Pathway PWY-7686
- taxonomic range:
- common name:
- L-malate degradation II
- Synonym(s):
- (S)--malate degradation II
Reaction(s) found
1 reactions found over 1 reactions in the full pathway
- 1.1.1.39-RXN
- 3 associated gene(s):
- 3 reconstruction source(s) associated: