Difference between revisions of "PWY-7356"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYANURIC-ACID CYANURIC-ACID] == * smiles: ** C1(O)(=NC(O)=NC(O)=N1) * inchi key: ** InChIKey=ZF...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7356 PWY-7356] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYANURIC-ACID CYANURIC-ACID] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7356 PWY-7356] ==
* smiles:
+
* taxonomic range:
** C1(O)(=NC(O)=NC(O)=N1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
** InChIKey=ZFSLODLOARCGLH-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** cyanurate
+
** thiamine salvage IV (yeast)
* molecular weight:
+
** 129.075   
+
 
* Synonym(s):
 
* Synonym(s):
** cyanuric acid
+
** thiamin salvage IV (yeast)
** 2,4,6-trihydroxy-s-triazine
+
** sym-triazine-2,4,6-triol
+
** 1,3,5-triazine-2,4,6-triol
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[R468-RXN]]
+
'''5''' reactions found over '''7''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[PYRIMSYN3-RXN]]
== Reaction(s) of unknown directionality ==
+
** 4 associated gene(s):
 +
*** [[Tiso_gene_2159]]
 +
*** [[Tiso_gene_16224]]
 +
*** [[Tiso_gene_17192]]
 +
*** [[Tiso_gene_2160]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXNQT-4191]]
 +
** 5 associated gene(s):
 +
*** [[Tiso_gene_4497]]
 +
*** [[Tiso_gene_15256]]
 +
*** [[Tiso_gene_17625]]
 +
*** [[Tiso_gene_11838]]
 +
*** [[Tiso_gene_17610]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[THI-P-SYN-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_10320]]
 +
*** [[Tiso_gene_2159]]
 +
*** [[Tiso_gene_2160]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_16512]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[THIAZOLSYN3-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_3173]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=OHMETPYRKIN-RXN OHMETPYRKIN-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=THIAMINASE-RXN THIAMINASE-RXN]
 
== External links  ==
 
== External links  ==
* NCI:
+
{{#set: taxonomic range=TAX-2}}
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=6284 6284]
+
{{#set: taxonomic range=TAX-4751}}
* CAS : 108-80-5
+
{{#set: common name=thiamine salvage IV (yeast)}}
* PUBCHEM:
+
{{#set: common name=thiamin salvage IV (yeast)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7956 7956]
+
{{#set: reaction found=5}}
* HMDB : HMDB41861
+
{{#set: total reaction=7}}
* LIGAND-CPD:
+
{{#set: completion rate=71.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C06554 C06554]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.7668.html 7668]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38028 38028]
+
{{#set: smiles=C1(O)(=NC(O)=NC(O)=N1)}}
+
{{#set: inchi key=InChIKey=ZFSLODLOARCGLH-UHFFFAOYSA-N}}
+
{{#set: common name=cyanurate}}
+
{{#set: molecular weight=129.075    }}
+
{{#set: common name=cyanuric acid|2,4,6-trihydroxy-s-triazine|sym-triazine-2,4,6-triol|1,3,5-triazine-2,4,6-triol}}
+
{{#set: consumed by=R468-RXN}}
+

Latest revision as of 20:08, 21 March 2018

Pathway PWY-7356

  • taxonomic range:
  • common name:
    • thiamine salvage IV (yeast)
  • Synonym(s):
    • thiamin salvage IV (yeast)

Reaction(s) found

5 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links