Difference between revisions of "CPD-15699"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-506 CPD-506] == * smiles: ** C1(O)(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-]...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15699 CPD-15699] == * smiles: ** [CH](=O)C(O)C(O)C(O)CO * common name: ** aldehydo-L-arabin...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15699 CPD-15699] == |
* smiles: | * smiles: | ||
− | ** | + | ** [CH](=O)C(O)C(O)C(O)CO |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** aldehydo-L-arabinose |
+ | * inchi key: | ||
+ | ** InChIKey=PYMYPHUHKUWMLA-VAYJURFESA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 150.131 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-14102]] | ||
+ | * [[RXN-14808]] | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460291 5460291] |
− | * | + | * CHEBI: |
− | {{#set: smiles= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6182 6182] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11476 C11476] |
− | {{#set: molecular weight= | + | {{#set: smiles=[CH](=O)C(O)C(O)C(O)CO}} |
− | {{#set: | + | {{#set: common name=aldehydo-L-arabinose}} |
− | + | {{#set: inchi key=InChIKey=PYMYPHUHKUWMLA-VAYJURFESA-N}} | |
− | + | {{#set: molecular weight=150.131 }} | |
+ | {{#set: reversible reaction associated=RXN-14102|RXN-14808}} |
Latest revision as of 19:08, 21 March 2018
Contents
Metabolite CPD-15699
- smiles:
- [CH](=O)C(O)C(O)C(O)CO
- common name:
- aldehydo-L-arabinose
- inchi key:
- InChIKey=PYMYPHUHKUWMLA-VAYJURFESA-N
- molecular weight:
- 150.131
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(O)C(O)C(O)CO" cannot be used as a page name in this wiki.