Difference between revisions of "CANAVANINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11690 CPD-11690] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)O * inchi key: ** InChIKey=R...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] == * smiles: ** C(CC([N+])C(=O)[O-])ONC(=[N+])N * common name: ** L-cana...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(CC([N+])C(=O)[O-])ONC(=[N+])N |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** L-canavanine |
| + | * inchi key: | ||
| + | ** InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 177.183 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** canavanine |
| − | ** | + | ** 2-amino-4-(guanidinooxy)butyrate |
| − | + | ** 2-amino-4-(guanidinooxy)butyric acid | |
| − | + | ||
| − | + | ||
| − | ** | + | |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-22]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CAS : 543-38-4 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=36688185 36688185] |
| − | * | + | * HMDB : HMDB02706 |
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78902 78902] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00308 C00308] |
| − | {{#set: | + | {{#set: smiles=C(CC([N+])C(=O)[O-])ONC(=[N+])N}} |
| − | {{#set: | + | {{#set: common name=L-canavanine}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O}} |
| − | {{#set: common name= | + | {{#set: molecular weight=177.183 }} |
| − | {{#set: | + | {{#set: common name=canavanine|2-amino-4-(guanidinooxy)butyrate|2-amino-4-(guanidinooxy)butyric acid}} |
| + | {{#set: produced by=RXN-22}} | ||
Latest revision as of 19:08, 21 March 2018
Contents
Metabolite CANAVANINE
- smiles:
- C(CC([N+])C(=O)[O-])ONC(=[N+])N
- common name:
- L-canavanine
- inchi key:
- InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O
- molecular weight:
- 177.183
- Synonym(s):
- canavanine
- 2-amino-4-(guanidinooxy)butyrate
- 2-amino-4-(guanidinooxy)butyric acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CC([N+])C(=O)[O-])ONC(=[N+])N" cannot be used as a page name in this wiki.
