Difference between revisions of "CPD-11690"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7163 RXN-7163] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11690 CPD-11690] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)O * common name: ** 1-oleoyl...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7163 RXN-7163] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11690 CPD-11690] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)O
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/2.7.1.158 EC-2.7.1.158]
+
** 1-oleoyl-sn-glycerol
 +
* inchi key:
 +
** InChIKey=RZRNAYUHWVFMIP-QJRAZLAKSA-N
 +
* molecular weight:
 +
** 356.545   
 
* Synonym(s):
 
* Synonym(s):
 +
** sn-glycerol 1-oleate
 +
** mono-oleoylglycerol
 +
** alpha-Monoolein
 +
** glycerol oleate
 +
** 1-oleylglycerol
 +
** 1-monoolein
 +
** mono-olein
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-15089]]
−
** 1 [[ATP]][c] '''+''' 1 [[CPD-1107]][c] '''=>''' 1 [[MI-HEXAKISPHOSPHATE]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[PROTON]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 ATP[c] '''+''' 1 D-myo-inositol 1,3,4,5,6-pentakisphosphate[c] '''=>''' 1 phytate[c] '''+''' 1 ADP[c] '''+''' 1 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_15282]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-6362]], 1D-myo-inositol hexakisphosphate biosynthesis II (mammalian): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6362 PWY-6362]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-6361]], 1D-myo-inositol hexakisphosphate biosynthesis I  (from Ins(1,4,5)P3): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6361 PWY-6361]
+
−
** '''2''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-4661]], 1D-myo-inositol hexakisphosphate biosynthesis III (Spirodela polyrrhiza): [http://metacyc.org/META/NEW-IMAGE?object=PWY-4661 PWY-4661]
+
−
** '''3''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-6369]], inositol pyrophosphates biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6369 PWY-6369]
+
−
** '''1''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-6554]], 1D-myo-inositol hexakisphosphate biosynthesis V (from Ins(1,3,4)P3): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6554 PWY-6554]
+
−
** '''4''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-6372]], 1D-myo-inositol hexakisphosphate biosynthesis IV (Dictyostelium): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6372 PWY-6372]
+
−
** '''3''' reactions found over '''7''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20313 20313]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12178130 12178130]
−
* LIGAND-RXN:
+
* CHEMSPIDER:
−
** [http://www.genome.jp/dbget-bin/www_bget?R05202 R05202]
+
** [http://www.chemspider.com/Chemical-Structure.4446588.html 4446588]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: ec number=EC-2.7.1.158}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75757 75757]
−
{{#set: gene associated=Tiso_gene_15282}}
+
* HMDB : HMDB11567
−
{{#set: in pathway=PWY-6362|PWY-6361|PWY-4661|PWY-6369|PWY-6554|PWY-6372}}
+
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)O}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=1-oleoyl-sn-glycerol}}
−
{{#set: reconstruction source=orthology-esiliculosus}}
+
{{#set: inchi key=InChIKey=RZRNAYUHWVFMIP-QJRAZLAKSA-N}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: molecular weight=356.545    }}
 +
{{#set: common name=sn-glycerol 1-oleate|mono-oleoylglycerol|alpha-Monoolein|glycerol oleate|1-oleylglycerol|1-monoolein|mono-olein}}
 +
{{#set: consumed by=RXN-15089}}

Latest revision as of 19:08, 21 March 2018

Metabolite CPD-11690

  • smiles:
    • CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)O
  • common name:
    • 1-oleoyl-sn-glycerol
  • inchi key:
    • InChIKey=RZRNAYUHWVFMIP-QJRAZLAKSA-N
  • molecular weight:
    • 356.545
  • Synonym(s):
    • sn-glycerol 1-oleate
    • mono-oleoylglycerol
    • alpha-Monoolein
    • glycerol oleate
    • 1-oleylglycerol
    • 1-monoolein
    • mono-olein

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-11690&oldid=39695"