Difference between revisions of "Tiso gene 727"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14404 CPD-14404] == * smiles: ** CCCCCC=CCC=CCC=CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
(Created page with "Category:Gene == Gene Tiso_gene_727 == * right end position: ** 2262 * transcription direction: ** POSITIVE * left end position: ** 97 * centisome position: ** 0.33425224...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14404 CPD-14404] ==
+
== Gene Tiso_gene_727 ==
−
* smiles:
+
* right end position:
−
** CCCCCC=CCC=CCC=CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 2262
−
* inchi key:
+
* transcription direction:
−
** InChIKey=DJFXNRBQUUFIOS-DDQUOPDJSA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 3-oxo-dihomo γ-linolenoyl-CoA
+
** 97
−
* molecular weight:
+
* centisome position:
−
** 1065.958    
+
** 0.33425224    
 
* Synonym(s):
 
* Synonym(s):
−
** (8Z,11Z,14Z)-3-oxo-icosa-8,11,14-trienoyl-CoA
 
−
** (8Z,11Z,14Z)-3-oxo-icosatrienoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12968]]
+
* Reaction: [[3.5.1.98-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2262}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70698343 70698343]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=97}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71481 71481]
+
{{#set: centisome position=0.33425224   }}
−
{{#set: smiles=CCCCCC=CCC=CCC=CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=3.5.1.98-RXN}}
−
{{#set: inchi key=InChIKey=DJFXNRBQUUFIOS-DDQUOPDJSA-J}}
+
−
{{#set: common name=3-oxo-dihomo γ-linolenoyl-CoA}}
+
−
{{#set: molecular weight=1065.958   }}
+
−
{{#set: common name=(8Z,11Z,14Z)-3-oxo-icosa-8,11,14-trienoyl-CoA|(8Z,11Z,14Z)-3-oxo-icosatrienoyl-CoA}}
+
−
{{#set: consumed by=RXN-12968}}
+

Latest revision as of 19:08, 21 March 2018

Gene Tiso_gene_727

  • right end position:
    • 2262
  • transcription direction:
    • POSITIVE
  • left end position:
    • 97
  • centisome position:
    • 0.33425224
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_727&oldid=39706"