Difference between revisions of "Tiso gene 284"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-27 CPD66-27] == * smiles: ** CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4)) *...")
(Created page with "Category:Gene == Gene Tiso_gene_284 == * right end position: ** 25515 * transcription direction: ** POSITIVE * left end position: ** 22290 * centisome position: ** 61.0768...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-27 CPD66-27] ==
+
== Gene Tiso_gene_284 ==
−
* smiles:
+
* right end position:
−
** CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4))
+
** 25515
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RCFJDVCRANOZEL-UHFFFAOYSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** pregn-5-ene-3,20-dione-17-ol
+
** 22290
−
* molecular weight:
+
* centisome position:
−
** 330.466    
+
** 61.076862    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[METHIONINE--TRNA-LIGASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN66-350]]
+
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-16165]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[TRNA-CHARGING-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=25515}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14562950 14562950]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4))}}
+
{{#set: left end position=22290}}
−
{{#set: inchi key=InChIKey=RCFJDVCRANOZEL-UHFFFAOYSA-N}}
+
{{#set: centisome position=61.076862   }}
−
{{#set: common name=pregn-5-ene-3,20-dione-17-ol}}
+
{{#set: reaction associated=METHIONINE--TRNA-LIGASE-RXN|RXN-16165}}
−
{{#set: molecular weight=330.466   }}
+
{{#set: pathway associated=TRNA-CHARGING-PWY}}
−
{{#set: reversible reaction associated=RXN66-350}}
+

Latest revision as of 19:08, 21 March 2018

Gene Tiso_gene_284

  • right end position:
    • 25515
  • transcription direction:
    • POSITIVE
  • left end position:
    • 22290
  • centisome position:
    • 61.076862
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_284&oldid=39732"