Difference between revisions of "PWY-5022"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAMINE DOPAMINE] == * smiles: ** C(CC1(C=C(C(=CC=1)O)O))[N+] * inchi key: ** InChIKey=VYFYYTL...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5022 PWY-5022] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-12...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5022 PWY-5022] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 4-aminobutanoate degradation V |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** GABA degradation |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''3''' reactions found over '''7''' reactions in the full pathway |
− | * [[ | + | * [[4-HYDROXYBUTYRATE-DEHYDROGENASE-RXN]] |
− | == Reaction(s) | + | ** 2 associated gene(s): |
− | == | + | *** [[Tiso_gene_777]] |
+ | *** [[Tiso_gene_91]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[GABATRANSAM-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_11231]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-synechocystis]] | ||
+ | * [[GLUTAMATE-DEHYDROGENASE-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_2337]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=BUTYRYL-COA-DEHYDROGENASE-RXN BUTYRYL-COA-DEHYDROGENASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=R11-RXN R11-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8889 RXN-8889] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8890 RXN-8890] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-1239}} | |
− | + | {{#set: common name=4-aminobutanoate degradation V}} | |
− | + | {{#set: common name=GABA degradation}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: total reaction=7}} | |
− | + | {{#set: completion rate=43.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:09, 21 March 2018
Pathway PWY-5022
- taxonomic range:
- common name:
- 4-aminobutanoate degradation V
- Synonym(s):
- GABA degradation
Reaction(s) found
3 reactions found over 7 reactions in the full pathway
- 4-HYDROXYBUTYRATE-DEHYDROGENASE-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- GABATRANSAM-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- GLUTAMATE-DEHYDROGENASE-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated: