Difference between revisions of "Tiso gene 12431"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-700 CPD-700] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C...")
(Created page with "Category:Gene == Gene Tiso_gene_12431 == * Synonym(s): == Reactions associated == * Reaction: RXN-14480 ** Source: orthology-esiliculosus * Reaction: [[RXN-14481]...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-700 CPD-700] ==
+
== Gene Tiso_gene_12431 ==
−
* smiles:
+
−
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
−
* inchi key:
+
−
** InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N
+
−
* common name:
+
−
** ergosta-5,7,24(28)-trien-3β-ol
+
−
* molecular weight:
+
−
** 396.655   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 5,7,24(28)-ergostatrienol
 
−
** 5-dehydro episterol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-707]]
+
* Reaction: [[RXN-14480]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
−
* [[RXN3O-218]]
+
* Reaction: [[RXN-14481]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN0-5063]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: reaction associated=RXN-14480|RXN-14481|RXN0-5063}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15780 C15780]
+
−
* HMDB : HMDB06848
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=52972 52972]
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10894570 10894570]
+
−
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
−
{{#set: inchi key=InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N}}
+
−
{{#set: common name=ergosta-5,7,24(28)-trien-3β-ol}}
+
−
{{#set: molecular weight=396.655    }}
+
−
{{#set: common name=5,7,24(28)-ergostatrienol|5-dehydro episterol}}
+
−
{{#set: consumed by=RXN-707}}
+
−
{{#set: produced by=RXN3O-218}}
+

Latest revision as of 19:09, 21 March 2018

Gene Tiso_gene_12431

  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12431&oldid=39806"