Difference between revisions of "DOPAMINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7250 PWY-7250] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAMINE DOPAMINE] == * smiles: ** C(CC1(C=C(C(=CC=1)O)O))[N+] * common name: ** dopamine * inc...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7250 PWY-7250] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAMINE DOPAMINE] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
** C(CC1(C=C(C(=CC=1)O)O))[N+]
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
+
 
* common name:
 
* common name:
−
** [2Fe-2S] iron-sulfur cluster biosynthesis
+
** dopamine
 +
* inchi key:
 +
** InChIKey=VYFYYTLLBUKUHU-UHFFFAOYSA-O
 +
* molecular weight:
 +
** 154.188   
 
* Synonym(s):
 
* Synonym(s):
−
** [Fe-S] cluster biosynthesis
+
** deoxyepinephrine
−
** [2Fe-2S] cluster biosynthesis
+
** hydroxytyramine
 +
** 3,4-dihydroxyphenethylamine
 +
** intropin
 +
** 2-(3,4-dihydroxyphenyl)ethylamine
 +
** 4-(2-aminoethyl)benzene-1,2-diol
 +
** 3-hydroxytyramine
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''10''' reactions found over '''10''' reactions in the full pathway
+
* [[RXN6666-9]]
−
* [[RXN-14381]]
+
* [[RXN6666-4]]
−
** 0 associated gene:
+
== Reaction(s) known to produce the compound ==
−
** 2 reconstruction source(s) associated:
+
== Reaction(s) of unknown directionality ==
−
*** [[annotation-experimental_annotation]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[RXN-14384]]
+
−
** 3 associated gene(s):
+
−
*** [[Tiso_gene_11478]]
+
−
*** [[Tiso_gene_14710]]
+
−
*** [[Tiso_gene_4284]]
+
−
** 3 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[RXN-14385]]
+
−
** 3 associated gene(s):
+
−
*** [[Tiso_gene_14710]]
+
−
*** [[Tiso_gene_11478]]
+
−
*** [[Tiso_gene_4284]]
+
−
** 3 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[RXN-14386]]
+
−
** 3 associated gene(s):
+
−
*** [[Tiso_gene_11478]]
+
−
*** [[Tiso_gene_14710]]
+
−
*** [[Tiso_gene_4284]]
+
−
** 3 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[RXN-14387]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_15502]]
+
−
** 3 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[RXN-14388]]
+
−
** 0 associated gene:
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[RXN-14389]]
+
−
** 0 associated gene:
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[annotation-experimental_annotation]]
+
−
* [[RXN-14390]]
+
−
** 0 associated gene:
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[RXN-14391]]
+
−
** 0 associated gene:
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[annotation-experimental_annotation]]
+
−
* [[RXN-15881]]
+
−
** 3 associated gene(s):
+
−
*** [[Tiso_gene_11478]]
+
−
*** [[Tiso_gene_14710]]
+
−
*** [[Tiso_gene_4284]]
+
−
** 3 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-2759}}
+
* CAS : 51-61-6
−
{{#set: taxonomic range=TAX-2}}
+
* BIGG : dopa
−
{{#set: taxonomic range=TAX-2157}}
+
* PUBCHEM:
−
{{#set: common name=[2Fe-2S] iron-sulfur cluster biosynthesis}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3713609 3713609]
−
{{#set: common name=[Fe-S] cluster biosynthesis|[2Fe-2S] cluster biosynthesis}}
+
* HMDB : HMDB00073
−
{{#set: reaction found=10}}
+
* LIGAND-CPD:
−
{{#set: total reaction=10}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C03758 C03758]
−
{{#set: completion rate=100.0}}
+
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.2944843.html 2944843]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59905 59905]
 +
* METABOLIGHTS : MTBLC59905
 +
{{#set: smiles=C(CC1(C=C(C(=CC=1)O)O))[N+]}}
 +
{{#set: common name=dopamine}}
 +
{{#set: inchi key=InChIKey=VYFYYTLLBUKUHU-UHFFFAOYSA-O}}
 +
{{#set: molecular weight=154.188    }}
 +
{{#set: common name=deoxyepinephrine|hydroxytyramine|3,4-dihydroxyphenethylamine|intropin|2-(3,4-dihydroxyphenyl)ethylamine|4-(2-aminoethyl)benzene-1,2-diol|3-hydroxytyramine}}
 +
{{#set: consumed by=RXN6666-9|RXN6666-4}}

Latest revision as of 19:09, 21 March 2018

Metabolite DOPAMINE

  • smiles:
    • C(CC1(C=C(C(=CC=1)O)O))[N+]
  • common name:
    • dopamine
  • inchi key:
    • InChIKey=VYFYYTLLBUKUHU-UHFFFAOYSA-O
  • molecular weight:
    • 154.188
  • Synonym(s):
    • deoxyepinephrine
    • hydroxytyramine
    • 3,4-dihydroxyphenethylamine
    • intropin
    • 2-(3,4-dihydroxyphenyl)ethylamine
    • 4-(2-aminoethyl)benzene-1,2-diol
    • 3-hydroxytyramine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 51-61-6
  • BIGG : dopa
  • PUBCHEM:
  • HMDB : HMDB00073
  • LIGAND-CPD:
  • CHEMSPIDER:
  • CHEBI:
  • METABOLIGHTS : MTBLC59905
"C(CC1(C=C(C(=CC=1)O)O))[N+" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=DOPAMINE&oldid=39808"