Difference between revisions of "CPD-17331"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-HISTIDINOL-P L-HISTIDINOL-P] == * smiles: ** C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+]) * inchi key...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17331 CPD-17331] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17331 CPD-17331] == |
* smiles: | * smiles: | ||
− | ** | + | ** CCC=CCC=CCC=CCC=CCC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** (9Z,12Z,15Z,18Z,21Z)-tetracosapentaenoyl-CoA |
+ | * inchi key: | ||
+ | ** InChIKey=BNAMTMVBOVNNSH-AFQBPCMKSA-J | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 1104.05 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** tetracosapentaenoyl-CoA |
− | ** | + | ** all-cis-9,12,15,18,21-tetracosapentaenoyl-CoA |
− | ** | + | ** (9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoyl-CoA |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-16132]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-16131]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581213 71581213] |
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74083 74083] |
− | + | {{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} | |
− | {{#set: smiles= | + | {{#set: common name=(9Z,12Z,15Z,18Z,21Z)-tetracosapentaenoyl-CoA}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=BNAMTMVBOVNNSH-AFQBPCMKSA-J}} |
− | {{#set: | + | {{#set: molecular weight=1104.05 }} |
− | {{#set: molecular weight= | + | {{#set: common name=tetracosapentaenoyl-CoA|all-cis-9,12,15,18,21-tetracosapentaenoyl-CoA|(9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoyl-CoA}} |
− | {{#set: common name= | + | {{#set: consumed by=RXN-16132}} |
− | {{#set: consumed by= | + | {{#set: produced by=RXN-16131}} |
− | {{#set: produced by= | + |
Latest revision as of 19:24, 21 March 2018
Contents
Metabolite CPD-17331
- smiles:
- CCC=CCC=CCC=CCC=CCC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- common name:
- (9Z,12Z,15Z,18Z,21Z)-tetracosapentaenoyl-CoA
- inchi key:
- InChIKey=BNAMTMVBOVNNSH-AFQBPCMKSA-J
- molecular weight:
- 1104.05
- Synonym(s):
- tetracosapentaenoyl-CoA
- all-cis-9,12,15,18,21-tetracosapentaenoyl-CoA
- (9Z,12Z,15Z,18Z,21Z)-tetracosa-9,12,15,18,21-pentaenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CCC=CCC=CCC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.