Difference between revisions of "PWY-5970"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENT-KAUR-16-EN-19-OL ENT-KAUR-16-EN-19-OL] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(CO)CCCC...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5970 PWY-5970] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENT-KAUR-16-EN-19-OL ENT-KAUR-16-EN-19-OL] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5970 PWY-5970] ==
* smiles:
+
* taxonomic range:
** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(CO)CCCC(C)2[CH]3CC4))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
* inchi key:
+
** InChIKey=TUJQVRFWMWRMIO-XRNRSJMDSA-N
+
 
* common name:
 
* common name:
** ent-kaurenol
+
** fatty acids biosynthesis (yeast)
* molecular weight:
+
** 288.472   
+
 
* Synonym(s):
 
* Synonym(s):
** ent-kaur-16-en-19-ol
+
** type I fatty acids biosynthesis
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-5242]]
+
'''1''' reactions found over '''1''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[FATTY-ACYL-COA-SYNTHASE-RXN]]
* [[1.14.13.78-RXN]]
+
** 5 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_135]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=443465 443465]
+
{{#set: common name=fatty acids biosynthesis (yeast)}}
* CHEBI:
+
{{#set: common name=type I fatty acids biosynthesis}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29611 29611]
+
{{#set: reaction found=1}}
* LIGAND-CPD:
+
{{#set: total reaction=1}}
** [http://www.genome.jp/dbget-bin/www_bget?C11872 C11872]
+
{{#set: completion rate=100.0}}
* HMDB : HMDB36727
+
{{#set: smiles=C=C1(C4(CC3(C1)(CC[CH]2(C(C)(CO)CCCC(C)2[CH]3CC4))))}}
+
{{#set: inchi key=InChIKey=TUJQVRFWMWRMIO-XRNRSJMDSA-N}}
+
{{#set: common name=ent-kaurenol}}
+
{{#set: molecular weight=288.472    }}
+
{{#set: common name=ent-kaur-16-en-19-ol}}
+
{{#set: consumed by=RXN-5242}}
+
{{#set: produced by=1.14.13.78-RXN}}
+

Latest revision as of 19:10, 21 March 2018

Pathway PWY-5970

  • taxonomic range:
  • common name:
    • fatty acids biosynthesis (yeast)
  • Synonym(s):
    • type I fatty acids biosynthesis

Reaction(s) found

1 reactions found over 1 reactions in the full pathway

Reaction(s) not found

External links