Difference between revisions of "PWY-5739"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-131 CPD1F-131] == * smiles: ** CC(=CC=CC=C(C=CC=C(C=CC12(C(CC(CC1(C)O2)O)(C)C))C)C)C=CC=C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5739 PWY-5739] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-131 CPD1F-131] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5739 PWY-5739] ==
* smiles:
+
* taxonomic range:
** CC(=CC=CC=C(C=CC=C(C=CC12(C(CC(CC1(C)O2)O)(C)C))C)C)C=CC=C(C=CC3(=C(CC(CC3(C)C)O)C))C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=OFNSUWBAQRCHAV-UKGDUWIJSA-N
+
 
* common name:
 
* common name:
** antheraxanthin
+
** GDP-D-perosamine biosynthesis
* molecular weight:
+
** 584.881   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** GDP-α-D-perosamine biosynthesis
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-7985]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
* [[RXN-7979]]
+
* [[GDPMANDEHYDRA-RXN]]
* [[ANXANor]]
+
** 2 associated gene(s):
== Reaction(s) known to produce the compound ==
+
*** [[Tiso_gene_13093]]
* [[RXN-7978]]
+
*** [[Tiso_gene_13092]]
* [[RXN-7984]]
+
** 3 reconstruction source(s) associated:
== Reaction(s) of unknown directionality ==
+
*** [[orthology-athaliana]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8953 RXN-8953]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244322 25244322]
+
{{#set: common name=GDP-D-perosamine biosynthesis}}
* CHEBI:
+
{{#set: common name=GDP-α-D-perosamine biosynthesis}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27867 27867]
+
{{#set: reaction found=1}}
* LIGAND-CPD:
+
{{#set: total reaction=2}}
** [http://www.genome.jp/dbget-bin/www_bget?C08579 C08579]
+
{{#set: completion rate=50.0}}
{{#set: smiles=CC(=CC=CC=C(C=CC=C(C=CC12(C(CC(CC1(C)O2)O)(C)C))C)C)C=CC=C(C=CC3(=C(CC(CC3(C)C)O)C))C}}
+
{{#set: inchi key=InChIKey=OFNSUWBAQRCHAV-UKGDUWIJSA-N}}
+
{{#set: common name=antheraxanthin}}
+
{{#set: molecular weight=584.881    }}
+
{{#set: consumed by=RXN-7985|RXN-7979|ANXANor}}
+
{{#set: produced by=RXN-7978|RXN-7984}}
+

Latest revision as of 19:10, 21 March 2018

Pathway PWY-5739

  • taxonomic range:
  • common name:
    • GDP-D-perosamine biosynthesis
  • Synonym(s):
    • GDP-α-D-perosamine biosynthesis

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links