Difference between revisions of "GALACTARDEG-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] == * smiles: ** CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1) * inchi key: ** InCh...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GALACTARDEG-PWY GALACTARDEG-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=T...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GALACTARDEG-PWY GALACTARDEG-PWY] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** D-galactarate degradation I |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** D-galactarate catabolism | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''4''' reactions in the full pathway | |
| − | * [[ | + | * [[KDGALDOL-RXN]] |
| − | == Reaction(s) | + | ** 1 associated gene(s): |
| + | *** [[Tiso_gene_16237]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=GALACTARDEHYDRA-RXN GALACTARDEHYDRA-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=GKI-RXN GKI-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=TSA-REDUCT-RXN TSA-REDUCT-RXN] | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=GALACTARDEG-PWY GALACTARDEG-PWY] |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | {{#set: | + | {{#set: common name=D-galactarate degradation I}} |
| − | {{#set: | + | {{#set: common name=D-galactarate catabolism}} |
| − | {{#set: common name= | + | {{#set: reaction found=1}} |
| − | {{#set: | + | {{#set: total reaction=4}} |
| − | {{#set: | + | {{#set: completion rate=25.0}} |
Latest revision as of 19:24, 21 March 2018
Pathway GALACTARDEG-PWY
- taxonomic range:
- common name:
- D-galactarate degradation I
- Synonym(s):
- D-galactarate catabolism
Reaction(s) found
1 reactions found over 4 reactions in the full pathway
- KDGALDOL-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
