Difference between revisions of "PWY-5410"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-GLY CYS-GLY] == * smiles: ** C(C([O-])=O)NC(C(CS)[N+])=O * inchi key: ** InChIKey=ZUKPVRWZD...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5410 PWY-5410] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-31...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-GLY CYS-GLY] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5410 PWY-5410] ==
−
* smiles:
+
* taxonomic range:
−
** C(C([O-])=O)NC(C(CS)[N+])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193]
−
* inchi key:
+
−
** InChIKey=ZUKPVRWZDMRIEO-VKHMYHEASA-N
+
 
* common name:
 
* common name:
−
** L-cysteinyl-glycine
+
** traumatin and (Z)-3-hexen-1-yl acetate biosynthesis
−
* molecular weight:
+
−
** 178.206   
+
 
* Synonym(s):
 
* Synonym(s):
−
** Cys-Gly
+
** 13-lipoxygenase and 13-hydroperoxide lyase pathway
−
** cysteinylglycine
+
** 13-LOX and 13-HPL pathway
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-6622]]
+
'''1''' reactions found over '''9''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-1321]]
−
* [[RXN-6601]]
+
** 1 associated gene(s):
−
* [[RXN-18092]]
+
*** [[Tiso_gene_4463]]
−
* [[RXN-9157]]
+
** 1 reconstruction source(s) associated:
−
== Reaction(s) of unknown directionality ==
+
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=HYDROHEX-RXN HYDROHEX-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=LIPOXYGENASE-RXN LIPOXYGENASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11852 RXN-11852]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12299 RXN-12299]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1345 RXN-1345]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1346 RXN-1346]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1347 RXN-1347]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1349 RXN-1349]
 
== External links  ==
 
== External links  ==
−
* BIGG : cgly
+
* ARACYC:
−
* PUBCHEM:
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5410 PWY-5410]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7098621 7098621]
+
{{#set: taxonomic range=TAX-3193}}
−
* HMDB : HMDB00078
+
{{#set: common name=traumatin and (Z)-3-hexen-1-yl acetate biosynthesis}}
−
* LIGAND-CPD:
+
{{#set: common name=13-lipoxygenase and 13-hydroperoxide lyase pathway|13-LOX and 13-HPL pathway}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01419 C01419]
+
{{#set: reaction found=1}}
−
* CHEBI:
+
{{#set: total reaction=9}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61694 61694]
+
{{#set: completion rate=11.0}}
−
* METABOLIGHTS : MTBLC4047
+
−
{{#set: smiles=C(C([O-])=O)NC(C(CS)[N+])=O}}
+
−
{{#set: inchi key=InChIKey=ZUKPVRWZDMRIEO-VKHMYHEASA-N}}
+
−
{{#set: common name=L-cysteinyl-glycine}}
+
−
{{#set: molecular weight=178.206    }}
+
−
{{#set: common name=Cys-Gly|cysteinylglycine}}
+
−
{{#set: consumed by=RXN-6622}}
+
−
{{#set: produced by=RXN-6601|RXN-18092|RXN-9157}}
+

Latest revision as of 19:10, 21 March 2018

Pathway PWY-5410

  • taxonomic range:
  • common name:
    • traumatin and (Z)-3-hexen-1-yl acetate biosynthesis
  • Synonym(s):
    • 13-lipoxygenase and 13-hydroperoxide lyase pathway
    • 13-LOX and 13-HPL pathway

Reaction(s) found

1 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-5410&oldid=39938"