Difference between revisions of "RXN-1826"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] == * smiles: ** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1) * inc...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1826 RXN-1826] == * direction: ** REVERSIBLE * common name: ** thymidine_phosphorylase * ec num...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1826 RXN-1826] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** thymidine_phosphorylase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.4.1.1 EC-2.4.1.1] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | == | + | ** 1 [[Long-linear-glucans]][c] '''+''' 1 [[Pi]][c] '''<=>''' 1 [[Long-linear-glucans]][c] '''+''' 1 [[GLC-1-P]][c] |
| − | * [[ | + | * With common name(s): |
| − | * [[ | + | ** 1 a long-linear glucan[c] '''+''' 1 phosphate[c] '''<=>''' 1 a long-linear glucan[c] '''+''' 1 α-D-glucopyranose 1-phosphate[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_1011]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: common name=thymidine_phosphorylase}} | |
| − | + | {{#set: ec number=EC-2.4.1.1}} | |
| − | + | {{#set: gene associated=Tiso_gene_1011}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:11, 21 March 2018
Contents
Reaction RXN-1826
- direction:
- REVERSIBLE
- common name:
- thymidine_phosphorylase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Long-linear-glucans[c] + 1 Pi[c] <=> 1 Long-linear-glucans[c] + 1 GLC-1-P[c]
- With common name(s):
- 1 a long-linear glucan[c] + 1 phosphate[c] <=> 1 a long-linear glucan[c] + 1 α-D-glucopyranose 1-phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_1011
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
