|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=5.3.4.1-RXN 5.3.4.1-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4125 CPD-4125] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
| * common name: | | * common name: |
− | ** nucleoredoxin | + | ** avenasterol |
− | ** ORF | + | * inchi key: |
− | ** probable_protein_disulfide-isomerase | + | ** InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N |
− | * ec number: | + | * molecular weight: |
− | ** [http://enzyme.expasy.org/EC/5.3.4.1 EC-5.3.4.1] | + | ** 412.698 |
| * Synonym(s): | | * Synonym(s): |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[RXN-4209]] |
− | ** 1 [[Proteins-with-incorrect-disulfides]][c] '''<=>''' 1 [[Proteins-with-correct-disulfides]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 a protein with incorrect disulfide bonds[c] '''<=>''' 1 a protein with correct disulfide bonds[c]
| + | |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_7350]] | + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | * [[Tiso_gene_4244]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_4246]]
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | * [[Tiso_gene_15704]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_475]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_14313]]
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | == Pathways == | + | |
− | == Reconstruction information == | + | |
− | * Category: [[orthology]]
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * UNIPROT: | + | * PUBCHEM: |
− | ** [http://www.uniprot.org/uniprot/P13667 P13667] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12795736 12795736] |
− | ** [http://www.uniprot.org/uniprot/P11598 P11598]
| + | * HMDB : HMDB06851 |
− | ** [http://www.uniprot.org/uniprot/P21195 P21195]
| + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/P0AEG4 P0AEG4] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15782 C15782] |
− | ** [http://www.uniprot.org/uniprot/P29828 P29828] | + | {{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} |
− | ** [http://www.uniprot.org/uniprot/P32557 P32557] | + | {{#set: common name=avenasterol}} |
− | ** [http://www.uniprot.org/uniprot/Q27780 Q27780]
| + | {{#set: inchi key=InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N}} |
− | ** [http://www.uniprot.org/uniprot/P31810 P31810]
| + | {{#set: molecular weight=412.698 }} |
− | ** [http://www.uniprot.org/uniprot/Q9PDE2 Q9PDE2]
| + | {{#set: consumed by=RXN-4209}} |
− | ** [http://www.uniprot.org/uniprot/O27777 O27777]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JSN7 Q9JSN7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P45111 P45111]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0AEG6 P0AEG6]
| + | |
− | ** [http://www.uniprot.org/uniprot/O68904 O68904]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PCE7 Q9PCE7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PDF5 Q9PDF5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JSY5 Q9JSY5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9KPF0 Q9KPF0]
| + | |
− | ** [http://www.uniprot.org/uniprot/P95460 P95460]
| + | |
− | ** [http://www.uniprot.org/uniprot/P05307 P05307]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17967 P17967]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09102 P09102]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07237 P07237]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08003 P08003]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q922C8 Q922C8]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04785 P04785]
| + | |
− | ** [http://www.uniprot.org/uniprot/P55059 P55059]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q27553 Q27553]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30101 P30101]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M1Q4 Q7M1Q4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q04815 Q04815]
| + | |
− | ** [http://www.uniprot.org/uniprot/P39691 P39691]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34329 P34329]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q12730 Q12730]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43116 Q43116]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9TWZ1 Q9TWZ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/P52588 P52588]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q17967 Q17967]
| + | |
− | ** [http://www.uniprot.org/uniprot/P52234 P52234]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22263 O22263]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93358 P93358]
| + | |
− | ** [http://www.uniprot.org/uniprot/P80284 P80284]
| + | |
− | ** [http://www.uniprot.org/uniprot/P52589 P52589]
| + | |
− | ** [http://www.uniprot.org/uniprot/O48949 O48949]
| + | |
− | ** [http://www.uniprot.org/uniprot/P38661 P38661]
| + | |
− | ** [http://www.uniprot.org/uniprot/O13704 O13704]
| + | |
− | ** [http://www.uniprot.org/uniprot/O13811 O13811]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q10057 Q10057]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q92249 Q92249]
| + | |
− | {{#set: direction=REVERSIBLE}}
| + | |
− | {{#set: common name=nucleoredoxin}} | + | |
− | {{#set: common name=ORF}} | + | |
− | {{#set: common name=probable_protein_disulfide-isomerase}}
| + | |
− | {{#set: ec number=EC-5.3.4.1}} | + | |
− | {{#set: gene associated=Tiso_gene_7350|Tiso_gene_4244|Tiso_gene_4246|Tiso_gene_15704|Tiso_gene_475|Tiso_gene_14313}} | + | |
− | {{#set: in pathway=}}
| + | |
− | {{#set: reconstruction category=orthology|annotation}}
| + | |
− | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}}
| + | |
− | {{#set: reconstruction tool=pantograph|pathwaytools}}
| + | |