Difference between revisions of "ASN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6433 PWY-6433] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN ASN] == * smiles: ** C(CC(C(=O)[O-])[N+])(N)=O * common name: ** L-asparagine * inchi key:...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6433 PWY-6433] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN ASN] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** C(CC(C(=O)[O-])[N+])(N)=O
 
* common name:
 
* common name:
−
** hydroxylated fatty acid biosynthesis (plants)
+
** L-asparagine
 +
* inchi key:
 +
** InChIKey=DCXYFEDJOCDNAF-REOHCLBHSA-N
 +
* molecular weight:
 +
** 132.119   
 
* Synonym(s):
 
* Synonym(s):
 +
** asparagine
 +
** α-aminosuccinamic acid
 +
** (-)-asparagine
 +
** (S)-2,4-diamino-4-oxobutanoic acid
 +
** (S)-asparagine
 +
** 2,4-diamino-4-oxobutanoic acid, (S)-
 +
** 2-aminosuccinamic acid, L-
 +
** agedoite
 +
** altheine
 +
** asparagine acid
 +
** aspartic acid β-amide
 +
** butanoic acid, 2,4-diamino-4-oxo-, (S)-
 +
** L-2,4-diamino-4-oxobutanoic acid
 +
** L-asparatamine
 +
** L-β-asparagine
 +
** asn
 +
** N
 +
** L-asn
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''4''' reactions found over '''22''' reactions in the full pathway
+
* [[ASPARAGHYD-RXN]]
−
* [[RXN-13322]]
+
* [[ASPARAGINE--TRNA-LIGASE-RXN]]
−
** 1 associated gene(s):
+
* [[RME144]]
−
*** [[Tiso_gene_6671]]
+
== Reaction(s) known to produce the compound ==
−
** 1 reconstruction source(s) associated:
+
* [[RXN-12460]]
−
*** [[orthology-esiliculosus]]
+
* [[ASNSYNA-RXN]]
−
* [[RXN-14484]]
+
* [[ASNSYNB-RXN]]
−
** 1 associated gene(s):
+
== Reaction(s) of unknown directionality ==
−
*** [[Tiso_gene_9871]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[annotation-experimental_annotation]]
+
−
* [[RXN-14493]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_9871]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[RXN-16154]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_9871]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[annotation-experimental_annotation]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14485 RXN-14485]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14486 RXN-14486]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14488 RXN-14488]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14491 RXN-14491]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14492 RXN-14492]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14494 RXN-14494]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14495 RXN-14495]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16148 RXN-16148]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16149 RXN-16149]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16150 RXN-16150]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16151 RXN-16151]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16152 RXN-16152]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16153 RXN-16153]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16155 RXN-16155]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16156 RXN-16156]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16157 RXN-16157]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16158 RXN-16158]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9670 RXN-9670]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-33090}}
+
* CAS : 70-47-3
−
{{#set: common name=hydroxylated fatty acid biosynthesis (plants)}}
+
* BIGG : asn__L
−
{{#set: reaction found=4}}
+
* PUBCHEM:
−
{{#set: total reaction=22}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6992089 6992089]
−
{{#set: completion rate=18.0}}
+
* HMDB : HMDB00168
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C00152 C00152]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58048 58048]
 +
* METABOLIGHTS : MTBLC58048
 +
{{#set: smiles=C(CC(C(=O)[O-])[N+])(N)=O}}
 +
{{#set: common name=L-asparagine}}
 +
{{#set: inchi key=InChIKey=DCXYFEDJOCDNAF-REOHCLBHSA-N}}
 +
{{#set: molecular weight=132.119    }}
 +
{{#set: common name=asparagine|α-aminosuccinamic acid|(-)-asparagine|(S)-2,4-diamino-4-oxobutanoic acid|(S)-asparagine|2,4-diamino-4-oxobutanoic acid, (S)-|2-aminosuccinamic acid, L-|agedoite|altheine|asparagine acid|aspartic acid β-amide|butanoic acid, 2,4-diamino-4-oxo-, (S)-|L-2,4-diamino-4-oxobutanoic acid|L-asparatamine|L-β-asparagine|asn|N|L-asn}}
 +
{{#set: consumed by=ASPARAGHYD-RXN|ASPARAGINE--TRNA-LIGASE-RXN|RME144}}
 +
{{#set: produced by=RXN-12460|ASNSYNA-RXN|ASNSYNB-RXN}}

Latest revision as of 19:12, 21 March 2018

Metabolite ASN

  • smiles:
    • C(CC(C(=O)[O-])[N+])(N)=O
  • common name:
    • L-asparagine
  • inchi key:
    • InChIKey=DCXYFEDJOCDNAF-REOHCLBHSA-N
  • molecular weight:
    • 132.119
  • Synonym(s):
    • asparagine
    • α-aminosuccinamic acid
    • (-)-asparagine
    • (S)-2,4-diamino-4-oxobutanoic acid
    • (S)-asparagine
    • 2,4-diamino-4-oxobutanoic acid, (S)-
    • 2-aminosuccinamic acid, L-
    • agedoite
    • altheine
    • asparagine acid
    • aspartic acid β-amide
    • butanoic acid, 2,4-diamino-4-oxo-, (S)-
    • L-2,4-diamino-4-oxobutanoic acid
    • L-asparatamine
    • L-β-asparagine
    • asn
    • N
    • L-asn

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 70-47-3
  • BIGG : asn__L
  • PUBCHEM:
  • HMDB : HMDB00168
  • LIGAND-CPD:
  • CHEBI:
  • METABOLIGHTS : MTBLC58048
"C(CC(C(=O)[O-])[N+])(N)=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ASN&oldid=40103"