Difference between revisions of "Tiso gene 3579"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12159 CPD-12159] == * smiles: ** CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC...")
(Created page with "Category:Gene == Gene Tiso_gene_3579 == * Synonym(s): == Reactions associated == * Reaction: R93 ** Source: orthology-synechocystis * Reaction: R94 ** Source:...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12159 CPD-12159] ==
+
== Gene Tiso_gene_3579 ==
* smiles:
+
** CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC(C)45))))
+
* inchi key:
+
** InChIKey=PARCYOHVCUKSCA-BJDKXSRUSA-N
+
* common name:
+
** 26,27-dehydrozymosterol
+
* molecular weight:
+
** 382.628   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-11201]]
+
* Reaction: [[R93]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-synechocystis]]
== Reaction(s) of unknown directionality ==
+
* Reaction: [[R94]]
 +
** Source: [[orthology-synechocystis]]
 +
* Reaction: [[RXN-8024]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-6287]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=R93|R94|RXN-8024}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820155 91820155]
+
{{#set: pathway associated=PWY-6287}}
{{#set: smiles=CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC(C)45))))}}
+
{{#set: inchi key=InChIKey=PARCYOHVCUKSCA-BJDKXSRUSA-N}}
+
{{#set: common name=26,27-dehydrozymosterol}}
+
{{#set: molecular weight=382.628    }}
+
{{#set: consumed by=RXN-11201}}
+

Latest revision as of 19:12, 21 March 2018

Gene Tiso_gene_3579

  • Synonym(s):

Reactions associated

Pathways associated

External links