Difference between revisions of "Tiso gene 10771"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINAL HISTIDINAL] == * smiles: ** C1(NC=NC=1CC([CH]=O)[N+]) * inchi key: ** InChIKey=VYOIE...") |
(Created page with "Category:Gene == Gene Tiso_gene_10771 == * Synonym(s): == Reactions associated == * Reaction: ATPASE-RXN ** Source: orthology-athaliana == Pathways associated ==...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_10771 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[ | + | * Reaction: [[ATPASE-RXN]] |
| − | + | ** Source: [[orthology-athaliana]] | |
| − | + | == Pathways associated == | |
| − | * [[ | + | |
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=ATPASE-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 19:24, 21 March 2018
Gene Tiso_gene_10771
- Synonym(s):
Reactions associated
- Reaction: ATPASE-RXN
- Source: orthology-athaliana
