Difference between revisions of "CPD-3483"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7112 PWY-7112] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] == * smiles: ** CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1) * common name: ** hy...") |
||
| (4 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1) |
* common name: | * common name: | ||
| − | ** | + | ** hydroxybupropion |
| + | * inchi key: | ||
| + | ** InChIKey=AKOAEVOSDHIVFX-UHFFFAOYSA-O | ||
| + | * molecular weight: | ||
| + | ** 256.752 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN66-181]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == Reaction(s) | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202442 25202442] |
| − | {{#set: | + | * HMDB : HMDB12235 |
| − | {{#set: | + | {{#set: smiles=CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1)}} |
| + | {{#set: common name=hydroxybupropion}} | ||
| + | {{#set: inchi key=InChIKey=AKOAEVOSDHIVFX-UHFFFAOYSA-O}} | ||
| + | {{#set: molecular weight=256.752 }} | ||
| + | {{#set: produced by=RXN66-181}} | ||
Latest revision as of 19:24, 21 March 2018
Contents
Metabolite CPD-3483
- smiles:
- CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1)
- common name:
- hydroxybupropion
- inchi key:
- InChIKey=AKOAEVOSDHIVFX-UHFFFAOYSA-O
- molecular weight:
- 256.752
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB12235
"CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1)" cannot be used as a page name in this wiki.
