Difference between revisions of "PWY-3"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-10-METHENYL-THF 5-10-METHENYL-THF] == * smiles: ** C4(NC1(N=C(N)NC(=O)C=1[N+]3(=CN(C2(=CC=C(C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3 PWY-3] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] * common...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-10-METHENYL-THF 5-10-METHENYL-THF] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3 PWY-3] ==
−
* smiles:
+
* taxonomic range:
−
** C4(NC1(N=C(N)NC(=O)C=1[N+]3(=CN(C2(=CC=C(C=C2)C(=O)NC(CCC([O-])=O)C([O-])=O))C[CH]34)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=MEANFMOQMXYMCT-OLZOCXBDSA-M
+
 
* common name:
 
* common name:
−
** 5,10-methenyltetrahydrofolate mono-L-glutamate
+
** putrescine degradation V
−
* molecular weight:
+
−
** 454.421   
+
 
* Synonym(s):
 
* Synonym(s):
−
** N5-N10-CH-THF mono-L-glutamate
 
−
** N5-N10-methenyltetrahydrofolate mono-L-glutamate
 
−
** CH-THF mono-L-glutamate
 
−
** 5,10-methenyl-THF mono-L-glutamate
 
−
** anhydroleucovorin mono-L-glutamate
 
−
** methenyl-tetrahydrofolate mono-L-glutamate
 
−
** methenyl-THF mono-L-glutamate
 
−
** methenyl-H4F mono-L-glutamate
 
−
** 5,10-methenyl-H4PteGlu1
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''2''' reactions in the full pathway
−
* [[MTHFCx]]
+
* [[AMINOBUTDEHYDROG-RXN]]
−
* [[FGFTm]]
+
** 1 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_17322]]
−
* [[METHFtm]]
+
** 1 reconstruction source(s) associated:
−
* [[R01655]]
+
*** [[annotation-in-silico_annotation]]
−
* [[METHFth]]
+
== Reaction(s) not found ==
−
* [[MTHFor_nadp]]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8 RXN-8]
−
* [[R01220]]
+
−
* [[METHFtx]]
+
 
== External links  ==
 
== External links  ==
−
* CAS : 7444-29-3
+
{{#set: taxonomic range=TAX-2}}
−
* METABOLIGHTS : MTBLC57455
+
{{#set: common name=putrescine degradation V}}
−
* PUBCHEM:
+
{{#set: reaction found=1}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878371 46878371]
+
{{#set: total reaction=2}}
−
* HMDB : HMDB01354
+
{{#set: completion rate=50.0}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00445 C00445]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57455 57455]
+
−
* BIGG : methf
+
−
{{#set: smiles=C4(NC1(N=C(N)NC(=O)C=1[N+]3(=CN(C2(=CC=C(C=C2)C(=O)NC(CCC([O-])=O)C([O-])=O))C[CH]34)))}}
+
−
{{#set: inchi key=InChIKey=MEANFMOQMXYMCT-OLZOCXBDSA-M}}
+
−
{{#set: common name=5,10-methenyltetrahydrofolate mono-L-glutamate}}
+
−
{{#set: molecular weight=454.421    }}
+
−
{{#set: common name=N5-N10-CH-THF mono-L-glutamate|N5-N10-methenyltetrahydrofolate mono-L-glutamate|CH-THF mono-L-glutamate|5,10-methenyl-THF mono-L-glutamate|anhydroleucovorin mono-L-glutamate|methenyl-tetrahydrofolate mono-L-glutamate|methenyl-THF mono-L-glutamate|methenyl-H4F mono-L-glutamate|5,10-methenyl-H4PteGlu1}}
+
−
{{#set: produced by=MTHFCx|FGFTm}}
+
−
{{#set: reversible reaction associated=METHFtm|R01655|METHFth|MTHFor_nadp|R01220|METHFtx}}
+

Latest revision as of 19:13, 21 March 2018

Pathway PWY-3

  • taxonomic range:
  • common name:
    • putrescine degradation V
  • Synonym(s):

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-3&oldid=40235"