Difference between revisions of "5-10-METHENYL-THF"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_20055 == * left end position: ** 20 * transcription direction: ** POSITIVE * right end position: ** 1584 * centisome position: ** 1.1117287...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-10-METHENYL-THF 5-10-METHENYL-THF] == * smiles: ** C4(NC1(N=C(N)NC(=O)C=1[N+]3(=CN(C2(=CC=C(C...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-10-METHENYL-THF 5-10-METHENYL-THF] == |
− | * | + | * smiles: |
− | ** | + | ** C4(NC1(N=C(N)NC(=O)C=1[N+]3(=CN(C2(=CC=C(C=C2)C(=O)NC(CCC([O-])=O)C([O-])=O))C[CH]34))) |
− | * | + | * common name: |
− | ** | + | ** 5,10-methenyltetrahydrofolate mono-L-glutamate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=MEANFMOQMXYMCT-OLZOCXBDSA-M |
− | * | + | * molecular weight: |
− | ** | + | ** 454.421 |
* Synonym(s): | * Synonym(s): | ||
+ | ** N5-N10-CH-THF mono-L-glutamate | ||
+ | ** N5-N10-methenyltetrahydrofolate mono-L-glutamate | ||
+ | ** CH-THF mono-L-glutamate | ||
+ | ** 5,10-methenyl-THF mono-L-glutamate | ||
+ | ** anhydroleucovorin mono-L-glutamate | ||
+ | ** methenyl-tetrahydrofolate mono-L-glutamate | ||
+ | ** methenyl-THF mono-L-glutamate | ||
+ | ** methenyl-H4F mono-L-glutamate | ||
+ | ** 5,10-methenyl-H4PteGlu1 | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[MTHFCx]] | |
− | + | * [[FGFTm]] | |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | * | + | * [[METHFtm]] |
− | * [[ | + | * [[R01655]] |
− | * | + | * [[METHFth]] |
− | + | * [[MTHFor_nadp]] | |
− | + | * [[R01220]] | |
− | + | * [[METHFtx]] | |
− | + | ||
− | * [[ | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 7444-29-3 |
− | {{#set: | + | * BIGG : methf |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878371 46878371] |
− | {{#set: | + | * HMDB : HMDB01354 |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00445 C00445] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57455 57455] | ||
+ | * METABOLIGHTS : MTBLC57455 | ||
+ | {{#set: smiles=C4(NC1(N=C(N)NC(=O)C=1[N+]3(=CN(C2(=CC=C(C=C2)C(=O)NC(CCC([O-])=O)C([O-])=O))C[CH]34)))}} | ||
+ | {{#set: common name=5,10-methenyltetrahydrofolate mono-L-glutamate}} | ||
+ | {{#set: inchi key=InChIKey=MEANFMOQMXYMCT-OLZOCXBDSA-M}} | ||
+ | {{#set: molecular weight=454.421 }} | ||
+ | {{#set: common name=N5-N10-CH-THF mono-L-glutamate|N5-N10-methenyltetrahydrofolate mono-L-glutamate|CH-THF mono-L-glutamate|5,10-methenyl-THF mono-L-glutamate|anhydroleucovorin mono-L-glutamate|methenyl-tetrahydrofolate mono-L-glutamate|methenyl-THF mono-L-glutamate|methenyl-H4F mono-L-glutamate|5,10-methenyl-H4PteGlu1}} | ||
+ | {{#set: produced by=MTHFCx|FGFTm}} | ||
+ | {{#set: reversible reaction associated=METHFtm|R01655|METHFth|MTHFor_nadp|R01220|METHFtx}} |
Latest revision as of 19:13, 21 March 2018
Contents
Metabolite 5-10-METHENYL-THF
- smiles:
- C4(NC1(N=C(N)NC(=O)C=1[N+]3(=CN(C2(=CC=C(C=C2)C(=O)NC(CCC([O-])=O)C([O-])=O))C[CH]34)))
- common name:
- 5,10-methenyltetrahydrofolate mono-L-glutamate
- inchi key:
- InChIKey=MEANFMOQMXYMCT-OLZOCXBDSA-M
- molecular weight:
- 454.421
- Synonym(s):
- N5-N10-CH-THF mono-L-glutamate
- N5-N10-methenyltetrahydrofolate mono-L-glutamate
- CH-THF mono-L-glutamate
- 5,10-methenyl-THF mono-L-glutamate
- anhydroleucovorin mono-L-glutamate
- methenyl-tetrahydrofolate mono-L-glutamate
- methenyl-THF mono-L-glutamate
- methenyl-H4F mono-L-glutamate
- 5,10-methenyl-H4PteGlu1
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 7444-29-3
- BIGG : methf
- PUBCHEM:
- HMDB : HMDB01354
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57455
"C4(NC1(N=C(N)NC(=O)C=1[N+]3(=CN(C2(=CC=C(C=C2)C(=O)NC(CCC([O-])=O)C([O-])=O))C[CH]34)))" cannot be used as a page name in this wiki.