Difference between revisions of "Guanine9-in-tRNA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFO-CYSTEINE SULFO-CYSTEINE] == * smiles: ** C(C([N+])C(=O)[O-])SS([O-])(=O)=O * inchi key: *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Guanine9-in-tRNA Guanine9-in-tRNA] == * common name: ** a guanine9 in tRNA * Synonym(s): == Re...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFO-CYSTEINE SULFO-CYSTEINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Guanine9-in-tRNA Guanine9-in-tRNA] ==
* smiles:
+
** C(C([N+])C(=O)[O-])SS([O-])(=O)=O
+
* inchi key:
+
** InChIKey=NOKPBJYHPHHWAN-REOHCLBHSA-M
+
 
* common name:
 
* common name:
** S-sulfo-L-cysteine
+
** a guanine9 in tRNA
* molecular weight:
+
** 200.204   
+
 
* Synonym(s):
 
* Synonym(s):
** S-sulfocysteine
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12459]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[SULFOCYS-RXN]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a guanine9 in tRNA}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203408 25203408]
+
{{#set: consumed by=RXN-12459}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62225 62225]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C05824 C05824]
+
* HMDB : HMDB00731
+
{{#set: smiles=C(C([N+])C(=O)[O-])SS([O-])(=O)=O}}
+
{{#set: inchi key=InChIKey=NOKPBJYHPHHWAN-REOHCLBHSA-M}}
+
{{#set: common name=S-sulfo-L-cysteine}}
+
{{#set: molecular weight=200.204    }}
+
{{#set: common name=S-sulfocysteine}}
+
{{#set: reversible reaction associated=SULFOCYS-RXN}}
+

Latest revision as of 20:13, 21 March 2018

Metabolite Guanine9-in-tRNA

  • common name:
    • a guanine9 in tRNA
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links