Difference between revisions of "CPD-14877"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14877 CPD-14877] == * smiles: ** CC(=O)NC1(=CC(C([O-])=O)=CC=C(O)1) * inchi key: ** InChIKe...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14877 CPD-14877] == * smiles: ** CC(=O)NC1(=CC(C([O-])=O)=CC=C(O)1) * common name: ** 3-ace...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(=O)NC1(=CC(C([O-])=O)=CC=C(O)1) | ** CC(=O)NC1(=CC(C([O-])=O)=CC=C(O)1) | ||
| − | |||
| − | |||
* common name: | * common name: | ||
** 3-acetylamino-4-hydroxybenzoate | ** 3-acetylamino-4-hydroxybenzoate | ||
| + | * inchi key: | ||
| + | ** InChIKey=BXBFVCYLJXGOGI-UHFFFAOYSA-M | ||
* molecular weight: | * molecular weight: | ||
** 194.166 | ** 194.166 | ||
| Line 20: | Line 20: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657256 90657256] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657256 90657256] | ||
{{#set: smiles=CC(=O)NC1(=CC(C([O-])=O)=CC=C(O)1)}} | {{#set: smiles=CC(=O)NC1(=CC(C([O-])=O)=CC=C(O)1)}} | ||
| − | |||
{{#set: common name=3-acetylamino-4-hydroxybenzoate}} | {{#set: common name=3-acetylamino-4-hydroxybenzoate}} | ||
| + | {{#set: inchi key=InChIKey=BXBFVCYLJXGOGI-UHFFFAOYSA-M}} | ||
{{#set: molecular weight=194.166 }} | {{#set: molecular weight=194.166 }} | ||
{{#set: common name=3-acetylamino-4-hydroxybenzoic acid}} | {{#set: common name=3-acetylamino-4-hydroxybenzoic acid}} | ||
{{#set: reversible reaction associated=RXN-13870}} | {{#set: reversible reaction associated=RXN-13870}} | ||
Latest revision as of 19:14, 21 March 2018
Contents
Metabolite CPD-14877
- smiles:
- CC(=O)NC1(=CC(C([O-])=O)=CC=C(O)1)
- common name:
- 3-acetylamino-4-hydroxybenzoate
- inchi key:
- InChIKey=BXBFVCYLJXGOGI-UHFFFAOYSA-M
- molecular weight:
- 194.166
- Synonym(s):
- 3-acetylamino-4-hydroxybenzoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(=O)NC1(=CC(C([O-])=O)=CC=C(O)1)" cannot be used as a page name in this wiki.
