Difference between revisions of "PWY-7659"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7087 CPD-7087] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O) *...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7659 PWY-7659] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7087 CPD-7087] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7659 PWY-7659] ==
* smiles:
+
* taxonomic range:
** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
* inchi key:
+
** InChIKey=KJXSIXMJHKAJOD-LSDHHAIUSA-M
+
 
* common name:
 
* common name:
** (+)-dihydromyricetin
+
** viridicatumtoxin biosynthesis
* molecular weight:
+
** 319.247   
+
 
* Synonym(s):
 
* Synonym(s):
** (+)-ampelopsin
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-8450]]
+
'''1''' reactions found over '''9''' reactions in the full pathway
* [[RXN-7784]]
+
* [[GPPSYN-RXN]]
== Reaction(s) known to produce the compound ==
+
** 9 associated gene(s):
* [[RXN-7922]]
+
*** [[Tiso_gene_19542]]
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_18201]]
 +
*** [[Tiso_gene_16284]]
 +
*** [[Tiso_gene_2848]]
 +
*** [[Tiso_gene_1035]]
 +
*** [[Tiso_gene_4719]]
 +
*** [[Tiso_gene_11582]]
 +
*** [[Tiso_gene_13582]]
 +
*** [[Tiso_gene_10317]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[manual-primary_network]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16575 RXN-16575]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16576 RXN-16576]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16577 RXN-16577]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16578 RXN-16578]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16579 RXN-16579]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16580 RXN-16580]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16581 RXN-16581]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16582 RXN-16582]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244375 25244375]
+
{{#set: common name=viridicatumtoxin biosynthesis}}
* CHEBI:
+
{{#set: reaction found=1}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28429 28429]
+
{{#set: total reaction=9}}
* METABOLIGHTS : MTBLC28429
+
{{#set: completion rate=11.0}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C02906 C02906]
+
{{#set: smiles=C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O)}}
+
{{#set: inchi key=InChIKey=KJXSIXMJHKAJOD-LSDHHAIUSA-M}}
+
{{#set: common name=(+)-dihydromyricetin}}
+
{{#set: molecular weight=319.247    }}
+
{{#set: common name=(+)-ampelopsin}}
+
{{#set: consumed by=RXN-8450|RXN-7784}}
+
{{#set: produced by=RXN-7922}}
+

Latest revision as of 19:14, 21 March 2018

Pathway PWY-7659

  • taxonomic range:
  • common name:
    • viridicatumtoxin biosynthesis
  • Synonym(s):

Reaction(s) found

1 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links