Difference between revisions of "CPD-17375"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15046 RXN-15046] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17375 CPD-17375] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)CO)=...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17375 CPD-17375] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)CO)=O |
| − | * | + | * common name: |
| − | ** | + | ** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol |
| + | * inchi key: | ||
| + | ** InChIKey=RCALBBVHQNUWNO-OSFDYRCISA-N | ||
| + | * molecular weight: | ||
| + | ** 650.978 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-16121]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820474 91820474] |
| − | {{#set: | + | {{#set: smiles=C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)CO)=O}} |
| − | {{#set: | + | {{#set: common name=1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=RCALBBVHQNUWNO-OSFDYRCISA-N}} |
| − | {{#set: | + | {{#set: molecular weight=650.978 }} |
| + | {{#set: produced by=RXN-16121}} | ||
Latest revision as of 19:14, 21 March 2018
Contents
Metabolite CPD-17375
- smiles:
- C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)CO)=O
- common name:
- 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol
- inchi key:
- InChIKey=RCALBBVHQNUWNO-OSFDYRCISA-N
- molecular weight:
- 650.978
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol" cannot be used as a page name in this wiki.
