Difference between revisions of "HISTIDINAL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-305 RXN66-305] == * direction: ** LEFT-TO-RIGHT * common name: ** 14-oxolanosterol deformylas...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINAL HISTIDINAL] == * smiles: ** C1(NC=NC=1CC([CH]=O)[N+]) * common name: ** histidinal *...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-305 RXN66-305] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINAL HISTIDINAL] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(NC=NC=1CC([CH]=O)[N+])
 
* common name:
 
* common name:
−
** 14-oxolanosterol deformylase
+
** histidinal
 +
* inchi key:
 +
** InChIKey=VYOIELONWKIZJS-YFKPBYRVSA-O
 +
* molecular weight:
 +
** 140.164   
 
* Synonym(s):
 
* Synonym(s):
 +
** L-histidinal
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[HISTALDEHYD-RXN]]
−
** 1 [[CPD-4573]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[FORMATE]][c] '''+''' 1 [[NADP]][c] '''+''' 1 [[44-DIMETHYL-CHOLESTA-812-24-TRIENOL]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 14-oxolanosterol[c] '''+''' 1 NADPH[c] '''+''' 1 oxygen[c] '''=>''' 1 H2O[c] '''+''' 1 formate[c] '''+''' 1 NADP+[c] '''+''' 1 4,4-dimethyl-cholesta-8,12,24-trienol[c]
+
* [[HISTOLDEHYD-RXN]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_8263]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY66-341]], cholesterol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-341 PWY66-341]
+
−
** '''8''' reactions found over '''22''' reactions in the full pathway
+
−
* [[PWY66-4]], cholesterol biosynthesis III (via desmosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-4 PWY66-4]
+
−
** '''7''' reactions found over '''22''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=14-oxolanosterol deformylase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=57339283 57339283]
−
{{#set: gene associated=Tiso_gene_8263}}
+
* HMDB : HMDB12234
−
{{#set: in pathway=PWY66-341|PWY66-4}}
+
* CHEBI:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64802 64802]
−
{{#set: reconstruction tool=pantograph}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=esiliculosus}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01929 C01929]
 +
{{#set: smiles=C1(NC=NC=1CC([CH]=O)[N+])}}
 +
{{#set: common name=histidinal}}
 +
{{#set: inchi key=InChIKey=VYOIELONWKIZJS-YFKPBYRVSA-O}}
 +
{{#set: molecular weight=140.164    }}
 +
{{#set: common name=L-histidinal}}
 +
{{#set: consumed by=HISTALDEHYD-RXN}}
 +
{{#set: reversible reaction associated=HISTOLDEHYD-RXN}}

Latest revision as of 19:24, 21 March 2018

Metabolite HISTIDINAL

  • smiles:
    • C1(NC=NC=1CC([CH]=O)[N+])
  • common name:
    • histidinal
  • inchi key:
    • InChIKey=VYOIELONWKIZJS-YFKPBYRVSA-O
  • molecular weight:
    • 140.164
  • Synonym(s):
    • L-histidinal

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(NC=NC=1CC([CH]=O)[N+])" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=HISTIDINAL&oldid=41390"