Difference between revisions of "Tiso gene 15682"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10826 CPD-10826] == * smiles: ** CC(C(=O)CC(=O)[O-])CC(=O)[O-] * inchi key: ** InChIKey=HKH...")
(Created page with "Category:Gene == Gene Tiso_gene_15682 == * Synonym(s): == Reactions associated == * Reaction: CYTOCHROME-C-OXIDASE-RXN ** Source: orthology-esiliculosus * Reactio...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10826 CPD-10826] ==
+
== Gene Tiso_gene_15682 ==
* smiles:
+
** CC(C(=O)CC(=O)[O-])CC(=O)[O-]
+
* inchi key:
+
** InChIKey=HKHNBKNLBZMXIV-UHFFFAOYSA-L
+
* common name:
+
** 4-methyl-3-oxoadipate
+
* molecular weight:
+
** 172.137   
+
 
* Synonym(s):
 
* Synonym(s):
** 4-methyl-3-ketoadipate
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[CYTOCHROME-C-OXIDASE-RXN]]
* [[RXN-10083]]
+
** Source: [[orthology-esiliculosus]]
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-15830]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-6692]]
 +
* [[PWY-7279]]
 +
* [[PWY-3781]]
 +
* [[PWY-4521]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=CYTOCHROME-C-OXIDASE-RXN|RXN-15830}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123441 44123441]
+
{{#set: pathway associated=PWY-6692|PWY-7279|PWY-3781|PWY-4521}}
{{#set: smiles=CC(C(=O)CC(=O)[O-])CC(=O)[O-]}}
+
{{#set: inchi key=InChIKey=HKHNBKNLBZMXIV-UHFFFAOYSA-L}}
+
{{#set: common name=4-methyl-3-oxoadipate}}
+
{{#set: molecular weight=172.137    }}
+
{{#set: common name=4-methyl-3-ketoadipate}}
+
{{#set: produced by=RXN-10083}}
+

Latest revision as of 19:15, 21 March 2018

Gene Tiso_gene_15682

  • Synonym(s):

Reactions associated

Pathways associated

External links