Difference between revisions of "Tiso gene 8780"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URIDINE URIDINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)) * inchi key: ** InChI...") |
(Created page with "Category:Gene == Gene Tiso_gene_8780 == * right end position: ** 9900 * transcription direction: ** POSITIVE * left end position: ** 8098 * centisome position: ** 81.79798...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_8780 == |
− | * | + | * right end position: |
− | ** | + | ** 9900 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 8098 |
− | * | + | * centisome position: |
− | ** | + | ** 81.79798 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[TETRAACYLDISACC4KIN-RXN]] |
− | * | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | + | == Pathways associated == | |
− | * | + | * [[NAGLIPASYN-PWY]] |
− | * | + | |
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=9900}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=8098}} | |
− | + | {{#set: centisome position=81.79798 }} | |
− | + | {{#set: reaction associated=TETRAACYLDISACC4KIN-RXN}} | |
− | + | {{#set: pathway associated=NAGLIPASYN-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:15, 21 March 2018
Gene Tiso_gene_8780
- right end position:
- 9900
- transcription direction:
- POSITIVE
- left end position:
- 8098
- centisome position:
- 81.79798
- Synonym(s):
Reactions associated
- Reaction: TETRAACYLDISACC4KIN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation