Difference between revisions of "3-carboxy-3-dimethylammonio-propyl-L-his"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TESTOSTERONE TESTOSTERONE] == * smiles: ** CC34([CH]2([CH]([CH]1(C(C)(C(O)CC1)CC2))CCC3=CC(=O)C...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-carboxy-3-dimethylammonio-propyl-L-his 3-carboxy-3-dimethylammonio-propyl-L-his] == * common...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TESTOSTERONE TESTOSTERONE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-carboxy-3-dimethylammonio-propyl-L-his 3-carboxy-3-dimethylammonio-propyl-L-his] ==
−
* smiles:
+
−
** CC34([CH]2([CH]([CH]1(C(C)(C(O)CC1)CC2))CCC3=CC(=O)CC4))
+
−
* inchi key:
+
−
** InChIKey=MUMGGOZAMZWBJJ-DYKIIFRCSA-N
+
 
* common name:
 
* common name:
−
** testosterone
+
** a 2-[(3S)-3-carboxy-3-(dimethylammonio)propyl]-L-histidine-[translation elongation factor 2]
−
* molecular weight:
+
−
** 288.429   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a 2-[3-carboxy-3-(dimethylammonio)propyl]-L-histidine in eEF-2
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN66-343]]
+
* [[RXN-11373]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11374]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB00624
+
{{#set: common name=a 2-[(3S)-3-carboxy-3-(dimethylammonio)propyl]-L-histidine-[translation elongation factor 2]}}
−
* Wikipedia : Testosterone
+
{{#set: common name=a 2-[3-carboxy-3-(dimethylammonio)propyl]-L-histidine in eEF-2}}
−
* LIPID_MAPS : LMST02020002
+
{{#set: consumed by=RXN-11373}}
−
* PUBCHEM:
+
{{#set: produced by=RXN-11374}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6013 6013]
+
−
* HMDB : HMDB00234
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00535 C00535]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.5215.html 5215]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17347 17347]
+
−
* METABOLIGHTS : MTBLC17347
+
−
{{#set: smiles=CC34([CH]2([CH]([CH]1(C(C)(C(O)CC1)CC2))CCC3=CC(=O)CC4))}}
+
−
{{#set: inchi key=InChIKey=MUMGGOZAMZWBJJ-DYKIIFRCSA-N}}
+
−
{{#set: common name=testosterone}}
+
−
{{#set: molecular weight=288.429    }}
+
−
{{#set: consumed by=RXN66-343}}
+

Latest revision as of 19:15, 21 March 2018

Metabolite 3-carboxy-3-dimethylammonio-propyl-L-his

  • common name:
    • a 2-[(3S)-3-carboxy-3-(dimethylammonio)propyl]-L-histidine-[translation elongation factor 2]
  • Synonym(s):
    • a 2-[3-carboxy-3-(dimethylammonio)propyl]-L-histidine in eEF-2

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a 2-[(3S)-3-carboxy-3-(dimethylammonio)propyl]-L-histidine-[translation elongation factor 2" cannot be used as a page name in this wiki.
"a 2-[3-carboxy-3-(dimethylammonio)propyl]-L-histidine in eEF-2" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=3-carboxy-3-dimethylammonio-propyl-L-his&oldid=40479"