Difference between revisions of "Tiso gene 1420"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13524 CPD-13524] == * smiles: ** CC(=CC=CC(C)=CCO)C=CC1(=C(C)CCCC(C)(C)1) * inchi key: ** I...") |
(Created page with "Category:Gene == Gene Tiso_gene_1420 == * right end position: ** 22665 * transcription direction: ** POSITIVE * left end position: ** 20240 * centisome position: ** 85.084...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_1420 == |
− | * | + | * right end position: |
− | ** | + | ** 22665 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 20240 |
− | * | + | * centisome position: |
− | ** | + | ** 85.084915 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[DIACYLGLYKIN-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: ec-number | |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | * [[ | + | * Reaction: [[NAD-KIN-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
− | * [[ | + | == Pathways associated == |
+ | * [[PWY-7268]] | ||
+ | * [[PWY-7269]] | ||
+ | * [[PWY-7817]] | ||
+ | * [[PWY-5083]] | ||
+ | * [[NADPHOS-DEPHOS-PWY-1]] | ||
+ | * [[PWY-7039]] | ||
+ | * [[NADPHOS-DEPHOS-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=22665}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=20240}} | |
− | + | {{#set: centisome position=85.084915 }} | |
− | + | {{#set: reaction associated=DIACYLGLYKIN-RXN|NAD-KIN-RXN}} | |
− | + | {{#set: pathway associated=PWY-7268|PWY-7269|PWY-7817|PWY-5083|NADPHOS-DEPHOS-PWY-1|PWY-7039|NADPHOS-DEPHOS-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:15, 21 March 2018
Gene Tiso_gene_1420
- right end position:
- 22665
- transcription direction:
- POSITIVE
- left end position:
- 20240
- centisome position:
- 85.084915
- Synonym(s):
Reactions associated
- Reaction: DIACYLGLYKIN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: NAD-KIN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation