Difference between revisions of "ASN-tRNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRANS-23-DEHYDROADIPYL-COA TRANS-23-DEHYDROADIPYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)N...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN-tRNAs ASN-tRNAs] == * common name: ** tRNAasn * Synonym(s): ** TRNA(ASN) == Reaction(s) kn...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRANS-23-DEHYDROADIPYL-COA TRANS-23-DEHYDROADIPYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN-tRNAs ASN-tRNAs] ==
* smiles:
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C=CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=ZFXICKRXPZTFPB-KCQRSJHASA-I
+
 
* common name:
 
* common name:
** trans-2,3-dehydroadipyl-coA
+
** tRNAasn
* molecular weight:
+
** 888.606   
+
 
* Synonym(s):
 
* Synonym(s):
** cis-2,3-didehydroadipyl-CoA
+
** TRNA(ASN)
** 2,3-didehydroadipyl-CoA
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ASPARAGINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12460]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-2425]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=tRNAasn}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70679154 70679154]
+
{{#set: common name=TRNA(ASN)}}
* CHEBI:
+
{{#set: consumed by=ASPARAGINE--TRNA-LIGASE-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71044 71044]
+
{{#set: produced by=RXN-12460}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C14144 C14144]
+
* HMDB : HMDB60392
+
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C=CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=ZFXICKRXPZTFPB-KCQRSJHASA-I}}
+
{{#set: common name=trans-2,3-dehydroadipyl-coA}}
+
{{#set: molecular weight=888.606    }}
+
{{#set: common name=cis-2,3-didehydroadipyl-CoA|2,3-didehydroadipyl-CoA}}
+
{{#set: reversible reaction associated=RXN-2425}}
+

Latest revision as of 20:16, 21 March 2018

Metabolite ASN-tRNAs

  • common name:
    • tRNAasn
  • Synonym(s):
    • TRNA(ASN)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links