Difference between revisions of "CPD-714"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6974 PWY-6974] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-714 CPD-714] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6974 PWY-6974] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-714 CPD-714] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 
* common name:
 
* common name:
** dTDP-L-olivose biosynthesis
+
** cathasterone
 +
* inchi key:
 +
** InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N
 +
* molecular weight:
 +
** 432.685   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''2''' reactions found over '''7''' reactions in the full pathway
+
* [[RXN-716]]
* [[DTDPGLUCDEHYDRAT-RXN]]
+
== Reaction(s) known to produce the compound ==
** 2 associated gene(s):
+
* [[RXN-715]]
*** [[Tiso_gene_12394]]
+
== Reaction(s) of unknown directionality ==
*** [[Tiso_gene_7329]]
+
** 4 reconstruction source(s) associated:
+
*** [[orthology-athaliana]]
+
*** [[annotation-in-silico_annotation]]
+
*** [[orthology-synechocystis]]
+
*** [[orthology-esiliculosus]]
+
* [[DTDPGLUCOSEPP-RXN]]
+
** 1 associated gene(s):
+
*** [[Tiso_gene_14704]]
+
** 1 reconstruction source(s) associated:
+
*** [[orthology-synechocystis]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12404 RXN-12404]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12928 RXN-12928]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12929 RXN-12929]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12943 RXN-12943]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16262 RXN-16262]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2}}
+
* PUBCHEM:
{{#set: common name=dTDP-L-olivose biosynthesis}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15341086 15341086]
{{#set: reaction found=2}}
+
* CHEBI:
{{#set: total reaction=7}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=23057 23057]
{{#set: completion rate=29.0}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C15790 C15790]
 +
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: common name=cathasterone}}
 +
{{#set: inchi key=InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N}}
 +
{{#set: molecular weight=432.685    }}
 +
{{#set: consumed by=RXN-716}}
 +
{{#set: produced by=RXN-715}}

Latest revision as of 20:16, 21 March 2018

Metabolite CPD-714

  • smiles:
    • CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • cathasterone
  • inchi key:
    • InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N
  • molecular weight:
    • 432.685
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.