|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=OHACYL-COA-DEHYDROG-RXN OHACYL-COA-DEHYDROG-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRANS-23-DEHYDROADIPYL-COA TRANS-23-DEHYDROADIPYL-COA] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C=CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| * common name: | | * common name: |
− | ** 3-hydroxyacyl-_dehydrogenase | + | ** trans-2,3-dehydroadipyl-coA |
− | ** hydroxyacyl-coenzyme_a_mitochondrial | + | * inchi key: |
− | ** hydroxyacyl-coenzyme_a_dehydrogenase_3-ketoacyl-coenzyme_a_thiolase_enoyl-coenzyme_a_hydratasealpha_subunit | + | ** InChIKey=ZFXICKRXPZTFPB-KCQRSJHASA-I |
− | * ec number: | + | * molecular weight: |
− | ** [http://enzyme.expasy.org/EC/1.1.1.35 EC-1.1.1.35] | + | ** 888.606 |
| * Synonym(s): | | * Synonym(s): |
| + | ** cis-2,3-didehydroadipyl-CoA |
| + | ** 2,3-didehydroadipyl-CoA |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 1 [[L-3-HYDROXYACYL-COA]][c] '''+''' 1 [[NAD]][c] '''=>''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[3-KETOACYL-COA]][c]
| + | == Reaction(s) of unknown directionality == |
− | * With common name(s):
| + | * [[RXN-2425]] |
− | ** 1 a (3S)-3-hydroxyacyl-CoA[c] '''+''' 1 NAD+[c] '''=>''' 1 NADH[c] '''+''' 1 H+[c] '''+''' 1 a 3-oxoacyl-CoA[c]
| + | |
− | | + | |
− | == Genes associated with this reaction ==
| + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_14262]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_14027]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_18838]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_18839]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_14026]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_5857]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | == Pathways == | + | |
− | * [[PWY-5136]], fatty acid β-oxidation II (peroxisome): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5136 PWY-5136]
| + | |
− | ** '''5''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-7007]], methyl ketone biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7007 PWY-7007]
| + | |
− | ** '''3''' reactions found over '''6''' reactions in the full pathway
| + | |
− | * [[FAO-PWY]], fatty acid β-oxidation I: [http://metacyc.org/META/NEW-IMAGE?object=FAO-PWY FAO-PWY]
| + | |
− | ** '''5''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[PWY66-391]], fatty acid β-oxidation VI (peroxisome): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-391 PWY66-391]
| + | |
− | ** '''5''' reactions found over '''7''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * Category: [[orthology]] | + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22432 22432] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70679154 70679154] |
− | * PIR:
| + | * HMDB : HMDB60392 |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A39592 A39592]
| + | * CHEBI: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A49613 A49613] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71044 71044] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A55045 A55045] | + | * LIGAND-CPD: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=DEPGC DEPGC] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C14144 C14144] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=DWRTEP DWRTEP]
| + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C=CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=JC4210 JC4210] | + | {{#set: common name=trans-2,3-dehydroadipyl-coA}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=JC4879 JC4879]
| + | {{#set: inchi key=InChIKey=ZFXICKRXPZTFPB-KCQRSJHASA-I}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=JX0199 JX0199] | + | {{#set: molecular weight=888.606 }} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S32607 S32607]
| + | {{#set: common name=cis-2,3-didehydroadipyl-CoA|2,3-didehydroadipyl-CoA}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S36678 S36678]
| + | {{#set: reversible reaction associated=RXN-2425}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S40743 S40743]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S54786 S54786]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S57651 S57651]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S74114 S74114]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T10464 T10464]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T46866 T46866]
| + | |
− | * LIGAND-RXN:
| + | |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R01778 R01778]
| + | |
− | * UNIPROT:
| + | |
− | ** [http://www.uniprot.org/uniprot/P21177 P21177]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q08426 Q08426]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q53924 Q53924]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07896 P07896]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q61425 Q61425]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q16836 Q16836]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28793 P28793]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22414 P22414]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M0E0 Q7M0E0]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34439 P34439]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01373 Q01373]
| + | |
− | ** [http://www.uniprot.org/uniprot/P55100 P55100]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q39659 Q39659]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00348 P00348]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}}
| + | |
− | {{#set: common name=3-hydroxyacyl-_dehydrogenase}} | + | |
− | {{#set: common name=hydroxyacyl-coenzyme_a_mitochondrial}} | + | |
− | {{#set: common name=hydroxyacyl-coenzyme_a_dehydrogenase_3-ketoacyl-coenzyme_a_thiolase_enoyl-coenzyme_a_hydratasealpha_subunit}}
| + | |
− | {{#set: ec number=EC-1.1.1.35}} | + | |
− | {{#set: gene associated=Tiso_gene_14262|Tiso_gene_14027|Tiso_gene_18838|Tiso_gene_18839|Tiso_gene_14026|Tiso_gene_5857}} | + | |
− | {{#set: in pathway=PWY-5136|PWY-7007|FAO-PWY|PWY66-391}}
| + | |
− | {{#set: reconstruction category=orthology|annotation}} | + | |
− | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}}
| + | |
− | {{#set: reconstruction tool=pantograph|pathwaytools}}
| + | |