Difference between revisions of "Tiso gene 15823"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11495 CPD-11495] == * smiles: ** C(=O)([O-])CC1(=CC=CC=C(O)1) * inchi key: ** InChIKey=CCVY...") |
(Created page with "Category:Gene == Gene Tiso_gene_15823 == * right end position: ** 1317 * transcription direction: ** POSITIVE * left end position: ** 694 * centisome position: ** 14.52794...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_15823 == |
− | * | + | * right end position: |
− | ** | + | ** 1317 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 694 |
− | * | + | * centisome position: |
− | ** | + | ** 14.527946 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[XYLULOKIN-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: automated-name-match |
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[DARABITOLUTIL-PWY]] | ||
+ | * [[LARABITOLUTIL-PWY]] | ||
+ | * [[XYLCAT-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=1317}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=694}} | |
− | + | {{#set: centisome position=14.527946 }} | |
− | + | {{#set: reaction associated=XYLULOKIN-RXN}} | |
− | + | {{#set: pathway associated=DARABITOLUTIL-PWY|LARABITOLUTIL-PWY|XYLCAT-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:16, 21 March 2018
Gene Tiso_gene_15823
- right end position:
- 1317
- transcription direction:
- POSITIVE
- left end position:
- 694
- centisome position:
- 14.527946
- Synonym(s):
Reactions associated
- Reaction: XYLULOKIN-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation