Difference between revisions of "CPD-11770"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9844 RXN-9844] == * direction: ** LEFT-TO-RIGHT * common name: ** (25R)-3α,7α-dihyd...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11770 CPD-11770] == * smiles: ** C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)CO)=2)) * common name: **...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9844 RXN-9844] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11770 CPD-11770] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)CO)=2))
 
* common name:
 
* common name:
−
** (25R)-3α,7α-dihydroxy-5β-cholestan-26-al 26-hydroxylase
+
** 7,8-dihydromonapterin
 +
* inchi key:
 +
** InChIKey=YQIFAMYNGGOTFB-NJGYIYPDSA-N
 +
* molecular weight:
 +
** 255.233   
 
* Synonym(s):
 
* Synonym(s):
 +
** DHM
 +
** H2-MPt
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[PROTON]][c] '''+''' 1 [[CPD-10587]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[Reduced-adrenal-ferredoxins]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[CPD-1834]][c] '''+''' 2 [[Oxidized-adrenal-ferredoxins]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN-10857]]
−
** 1 H+[c] '''+''' 1 (25R)-3α,7α-dihydroxy-5β-cholestan-26-al[c] '''+''' 1 oxygen[c] '''+''' 2 a reduced  adrenodoxin[c] '''=>''' 1 H2O[c] '''+''' 1 (25R)-3α,7α-dihydroxy-5-β-cholestanate[c] '''+''' 2 an oxidized adrenodoxin[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_7322]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-6061]], bile acid biosynthesis, neutral pathway: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6061 PWY-6061]
+
−
** '''3''' reactions found over '''29''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* LIGAND-CPD:
−
** [http://www.genome.jp/dbget-bin/www_bget?R04506 R04506]
+
** [http://www.genome.jp/dbget-bin/www_bget?C21008 C21008]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: common name=(25R)-3α,7α-dihydroxy-5β-cholestan-26-al 26-hydroxylase}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71175 71175]
−
{{#set: gene associated=Tiso_gene_7322}}
+
* PUBCHEM:
−
{{#set: in pathway=PWY-6061}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479435 45479435]
−
{{#set: reconstruction category=orthology}}
+
{{#set: smiles=C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)CO)=2))}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=7,8-dihydromonapterin}}
−
{{#set: reconstruction source=esiliculosus}}
+
{{#set: inchi key=InChIKey=YQIFAMYNGGOTFB-NJGYIYPDSA-N}}
 +
{{#set: molecular weight=255.233    }}
 +
{{#set: common name=DHM|H2-MPt}}
 +
{{#set: reversible reaction associated=RXN-10857}}

Latest revision as of 19:24, 21 March 2018

Metabolite CPD-11770

  • smiles:
    • C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)CO)=2))
  • common name:
    • 7,8-dihydromonapterin
  • inchi key:
    • InChIKey=YQIFAMYNGGOTFB-NJGYIYPDSA-N
  • molecular weight:
    • 255.233
  • Synonym(s):
    • DHM
    • H2-MPt

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-11770&oldid=41412"