Difference between revisions of "Tiso gene 13087"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11763 CPD-11763] == * smiles: ** C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NC...")
(Created page with "Category:Gene == Gene Tiso_gene_13087 == * right end position: ** 6476 * transcription direction: ** NEGATIVE * left end position: ** 1543 * centisome position: ** 23.5968...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11763 CPD-11763] ==
+
== Gene Tiso_gene_13087 ==
−
* smiles:
+
* right end position:
−
** C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O
+
** 6476
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** bisorganyltrisulfane
+
** 1543
−
* molecular weight:
+
* centisome position:
−
** 644.686    
+
** 23.59688    
 
* Synonym(s):
 
* Synonym(s):
−
** GS3G
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[BETA-GLUCURONID-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-10851]]
+
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-15289]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-15291]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7445]]
 +
* [[PWY-7247]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=6476}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479371 45479371]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O}}
+
{{#set: left end position=1543}}
−
{{#set: inchi key=InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L}}
+
{{#set: centisome position=23.59688   }}
−
{{#set: common name=bisorganyltrisulfane}}
+
{{#set: reaction associated=BETA-GLUCURONID-RXN|RXN-15289|RXN-15291}}
−
{{#set: molecular weight=644.686   }}
+
{{#set: pathway associated=PWY-7445|PWY-7247}}
−
{{#set: common name=GS3G}}
+
−
{{#set: reversible reaction associated=RXN-10851}}
+

Latest revision as of 19:16, 21 March 2018

Gene Tiso_gene_13087

  • right end position:
    • 6476
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 1543
  • centisome position:
    • 23.59688
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_13087&oldid=40587"