Difference between revisions of "CPD-11763"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-646 RXN-646] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/3.5....")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11763 CPD-11763] == * smiles: ** C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NC...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-646 RXN-646] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11763 CPD-11763] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O
* ec number:
+
* common name:
** [http://enzyme.expasy.org/EC/3.5.1.107 EC-3.5.1.107]
+
** bisorganyltrisulfane
 +
* inchi key:
 +
** InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L
 +
* molecular weight:
 +
** 644.686   
 
* Synonym(s):
 
* Synonym(s):
 +
** GS3G
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[WATER]][c] '''+''' 1 [[MALEAMATE]][c] '''=>''' 1 [[MALEATE]][c] '''+''' 1 [[AMMONIUM]][c]
+
== Reaction(s) of unknown directionality ==
* With common name(s):
+
* [[RXN-10851]]
** 1 H2O[c] '''+''' 1 maleamate[c] '''=>''' 1 maleate[c] '''+''' 1 ammonium[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_14341]]
+
** [[pantograph]]-[[athaliana]]
+
** [[pantograph]]-[[esiliculosus]]
+
== Pathways  ==
+
* [[PWY-6993]], nicotine degradation II (pyrrolidine pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6993 PWY-6993]
+
** '''2''' reactions found over '''11''' reactions in the full pathway
+
* [[PWY-722]], nicotinate degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-722 PWY-722]
+
** '''1''' reactions found over '''6''' reactions in the full pathway
+
* [[PWY-5033]], nicotinate degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5033 PWY-5033]
+
** '''1''' reactions found over '''5''' reactions in the full pathway
+
* [[PWY-7128]], nicotine degradation III (VPP pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7128 PWY-7128]
+
** '''1''' reactions found over '''10''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[orthology]]
+
** Source: [[orthology-athaliana]]
+
*** Tool: [[pantograph]]
+
** Source: [[orthology-esiliculosus]]
+
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
* PUBCHEM:
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27385 27385]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479371 45479371]
* LIGAND-RXN:
+
{{#set: smiles=C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O}}
** [http://www.genome.jp/dbget-bin/www_bget?R03540 R03540]
+
{{#set: common name=bisorganyltrisulfane}}
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: inchi key=InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L}}
{{#set: ec number=EC-3.5.1.107}}
+
{{#set: molecular weight=644.686    }}
{{#set: gene associated=Tiso_gene_14341}}
+
{{#set: common name=GS3G}}
{{#set: in pathway=PWY-6993|PWY-722|PWY-5033|PWY-7128}}
+
{{#set: reversible reaction associated=RXN-10851}}
{{#set: reconstruction category=orthology}}
+
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
+
{{#set: reconstruction tool=pantograph}}
+

Latest revision as of 19:16, 21 March 2018

Metabolite CPD-11763

  • smiles:
    • C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O
  • common name:
    • bisorganyltrisulfane
  • inchi key:
    • InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L
  • molecular weight:
    • 644.686
  • Synonym(s):
    • GS3G

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O" cannot be used as a page name in this wiki.