Difference between revisions of "CPD-19154"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5924 PWY-5924] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19154 CPD-19154] == * smiles: ** CCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19154 CPD-19154] == |
− | * | + | * smiles: |
− | ** [ | + | ** CCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* common name: | * common name: | ||
− | ** | + | ** (S)-3-hydroxy-(7Z)-tetradecenoyl-CoA |
+ | * inchi key: | ||
+ | ** InChIKey=WGCARZJTIJIWSL-JCJYIPITSA-J | ||
+ | * molecular weight: | ||
+ | ** 987.845 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** ( | + | ** (S)-3-hydroxy-14:1-Δ7-CoA |
− | ** ( | + | ** (S)-3-hydroxy-7-cis-tetradecenoyl-CoA |
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-17794]] | |
− | * [[RXN- | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-17793]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
− | * [ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | {{#set: smiles=CCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | {{#set: common name= | + | {{#set: common name=(S)-3-hydroxy-(7Z)-tetradecenoyl-CoA}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=WGCARZJTIJIWSL-JCJYIPITSA-J}} |
− | {{#set: | + | {{#set: molecular weight=987.845 }} |
− | {{#set: | + | {{#set: common name=(S)-3-hydroxy-14:1-Δ7-CoA|(S)-3-hydroxy-7-cis-tetradecenoyl-CoA}} |
− | {{#set: | + | {{#set: consumed by=RXN-17794}} |
+ | {{#set: produced by=RXN-17793}} |
Latest revision as of 19:17, 21 March 2018
Contents
Metabolite CPD-19154
- smiles:
- CCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- (S)-3-hydroxy-(7Z)-tetradecenoyl-CoA
- inchi key:
- InChIKey=WGCARZJTIJIWSL-JCJYIPITSA-J
- molecular weight:
- 987.845
- Synonym(s):
- (S)-3-hydroxy-14:1-Δ7-CoA
- (S)-3-hydroxy-7-cis-tetradecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.