Difference between revisions of "CPD-18550"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6342 PWY-6342] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7742 TAX-77...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O |
* common name: | * common name: | ||
| − | ** | + | ** quinoxaline-2-carboxyl adenylate |
| + | * inchi key: | ||
| + | ** InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M | ||
| + | * molecular weight: | ||
| + | ** 502.359 | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-17155]] | |
| − | * [[RXN- | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515331 102515331] |
| − | {{#set: | + | {{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O}} |
| − | + | {{#set: common name=quinoxaline-2-carboxyl adenylate}} | |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M}} |
| − | {{#set: | + | {{#set: molecular weight=502.359 }} |
| − | {{#set: | + | {{#set: consumed by=RXN-17155}} |
| − | {{#set: | + | |
Latest revision as of 19:18, 21 March 2018
Contents
Metabolite CPD-18550
- smiles:
- C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O
- common name:
- quinoxaline-2-carboxyl adenylate
- inchi key:
- InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M
- molecular weight:
- 502.359
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O" cannot be used as a page name in this wiki.
