Difference between revisions of "RXN1G-218"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBITOL RIBITOL] == * smiles: ** C(O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=HEBKCHPVOIAQTA-ZXF...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-218 RXN1G-218] == * direction: ** LEFT-TO-RIGHT * common name: ** cis-delta9-3-oxo-C28:1-[acy...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBITOL RIBITOL] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-218 RXN1G-218] ==
−
* smiles:
+
* direction:
−
** C(O)C(O)C(O)C(O)CO
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=HEBKCHPVOIAQTA-ZXFHETKHSA-N
+
 
* common name:
 
* common name:
−
** ribitol
+
** cis-delta9-3-oxo-C28:1-[acyl-carrier protein] synthase
−
* molecular weight:
+
* ec number:
−
** 152.147   
+
** [http://enzyme.expasy.org/EC/2.3.1.M1 EC-2.3.1.M1]
 
* Synonym(s):
 
* Synonym(s):
−
** meso-ribitol
 
−
** adonitol
 
−
** (2R,3s,4S)-pentane-1,2,3,4,5-pentol
 
−
** D-ribitol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[cis-delta7-cerotoyl-ACPs]][c] '''+''' 1 [[MALONYL-ACP]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[cis-delta9-3-oxo-montanoyl-ACPs]][c] '''+''' 1 [[ACP]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
−
* [[RIBITOL-2-DEHYDROGENASE-RXN]]
+
* With common name(s):
 +
** 1 a cis-delta7-C26:1-[acp][c] '''+''' 1 a malonyl-[acp][c] '''+''' 1 H+[c] '''=>''' 1 a cis-delta9-3-oxo-C28:1-[acp][c] '''+''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 CO2[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_19302]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_14485]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_15991]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''86''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 488-81-3
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* LIGAND-CPD:
+
{{#set: common name=cis-delta9-3-oxo-C28:1-[acyl-carrier protein] synthase}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00474 C00474]
+
{{#set: ec number=EC-2.3.1.M1}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_19302|Tiso_gene_14485|Tiso_gene_15991}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15963 15963]
+
{{#set: in pathway=PWYG-321}}
−
* METABOLIGHTS : MTBLC15963
+
{{#set: reconstruction category=orthology}}
−
* HMDB : HMDB00508
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
{{#set: smiles=C(O)C(O)C(O)C(O)CO}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=HEBKCHPVOIAQTA-ZXFHETKHSA-N}}
+
−
{{#set: common name=ribitol}}
+
−
{{#set: molecular weight=152.147    }}
+
−
{{#set: common name=meso-ribitol|adonitol|(2R,3s,4S)-pentane-1,2,3,4,5-pentol|D-ribitol}}
+
−
{{#set: consumed or produced by=RIBITOL-2-DEHYDROGENASE-RXN}}
+

Latest revision as of 19:24, 21 March 2018

Reaction RXN1G-218

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • cis-delta9-3-oxo-C28:1-[acyl-carrier protein] synthase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 86 reactions found over 182 reactions in the full pathway

Reconstruction information

External links

"cis-delta9-3-oxo-C28:1-[acyl-carrier protein] synthase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN1G-218&oldid=41434"