Difference between revisions of "Tiso gene 8889"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MONO-VINYL-PROTOCHLOROPHYLLIDE-A MONO-VINYL-PROTOCHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C...")
(Created page with "Category:Gene == Gene Tiso_gene_8889 == * Synonym(s): == Reactions associated == * Reaction: DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN ** Source: [[orthology-esiliculosus]...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MONO-VINYL-PROTOCHLOROPHYLLIDE-A MONO-VINYL-PROTOCHLOROPHYLLIDE-A] ==
+
== Gene Tiso_gene_8889 ==
−
* smiles:
+
−
** C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
−
* common name:
+
−
** protochlorophyllide a
+
−
* molecular weight:
+
−
** 610.951   
+
 
* Synonym(s):
 
* Synonym(s):
−
** monovinyl protochlorophyllide a
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[R03845]]
+
* Reaction: [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-12547]]
−
* [[RXN1F-10]]
+
** Source: [[orthology-creinhardtii]]
 +
== Pathways associated ==
 +
* [[TRIGLSYN-PWY]]
 
== External links  ==
 
== External links  ==
−
* CAS : 14751-08-7
+
{{#set: reaction associated=DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN|RXN-12547}}
−
* PUBCHEM:
+
{{#set: pathway associated=TRIGLSYN-PWY}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54749448 54749448]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57855 57855]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C02880 C02880]
+
−
* HMDB : HMDB31148
+
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
−
{{#set: common name=protochlorophyllide a}}
+
−
{{#set: molecular weight=610.951    }}
+
−
{{#set: common name=monovinyl protochlorophyllide a}}
+
−
{{#set: consumed by=R03845}}
+
−
{{#set: reversible reaction associated=RXN1F-10}}
+

Latest revision as of 19:18, 21 March 2018

Gene Tiso_gene_8889

  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_8889&oldid=40805"