Difference between revisions of "CPD-1091"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS] == * taxonomic range: ** [...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1091 CPD-1091] == * smiles: ** C(O)(C([O-])=O)NC(N)=O * common name: ** S-ureidoglycolate *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1091 CPD-1091] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
** C(O)(C([O-])=O)NC(N)=O
 
* common name:
 
* common name:
−
** protein N-glycosylation (eukaryotic, high mannose)
+
** S-ureidoglycolate
 +
* inchi key:
 +
** InChIKey=NWZYYCVIOKVTII-SFOWXEAESA-M
 +
* molecular weight:
 +
** 133.083   
 
* Synonym(s):
 
* Synonym(s):
−
** mannosyl-chito-dolichol biosynthesis
+
** (-)-ureidoglycolate
−
** eukaryotic N-linked glycosylation
+
** ureidoglycolate
−
** dolichyl-diphosphooligosaccharide biosynthesis and attachment
+
** S-(-)-ureidoglycolate
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''19''' reactions found over '''19''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[2.4.1.117-RXN]]
+
* [[ALLANTOICASE-RXN]]
−
** 1 associated gene(s):
+
== Reaction(s) of unknown directionality ==
−
*** [[Tiso_gene_8160]]
+
−
** 3 reconstruction source(s) associated:
+
−
*** [[orthology-athaliana]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[2.4.1.119-RXN]]
+
−
** 2 associated gene(s):
+
−
*** [[Tiso_gene_26]]
+
−
*** [[Tiso_gene_10448]]
+
−
** 3 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[2.4.1.141-RXN]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[2.4.1.142-RXN]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_8387]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[2.4.1.83-RXN]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_16772]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[2.7.8.15-RXN]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_1604]]
+
−
** 3 reconstruction source(s) associated:
+
−
*** [[orthology-athaliana]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[RXN-16592]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[RXN-16593]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[RXN-16594]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[RXN-5462]]
+
−
** 2 associated gene(s):
+
−
*** [[Tiso_gene_10734]]
+
−
*** [[Tiso_gene_16872]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[RXN-5463]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[RXN-5464]]
+
−
** 2 associated gene(s):
+
−
*** [[Tiso_gene_15849]]
+
−
*** [[Tiso_gene_15372]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[RXN-5466]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_8232]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[RXN-5467]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_8232]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[RXN-5468]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_8232]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[RXN-5469]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_8232]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[RXN-5470]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[RXN-5471]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[RXN-5472]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_15050]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-2759}}
+
* CAS : 2017665
−
{{#set: common name=protein N-glycosylation (eukaryotic, high mannose)}}
+
* PUBCHEM:
−
{{#set: common name=mannosyl-chito-dolichol biosynthesis|eukaryotic N-linked glycosylation|dolichyl-diphosphooligosaccharide biosynthesis and attachment}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615273 23615273]
−
{{#set: reaction found=19}}
+
* HMDB : HMDB01005
−
{{#set: total reaction=19}}
+
* LIGAND-CPD:
−
{{#set: completion rate=100.0}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00603 C00603]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.19951218.html 19951218]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57296 57296]
 +
* BIGG : urdglyc
 +
{{#set: smiles=C(O)(C([O-])=O)NC(N)=O}}
 +
{{#set: common name=S-ureidoglycolate}}
 +
{{#set: inchi key=InChIKey=NWZYYCVIOKVTII-SFOWXEAESA-M}}
 +
{{#set: molecular weight=133.083    }}
 +
{{#set: common name=(-)-ureidoglycolate|ureidoglycolate|S-(-)-ureidoglycolate}}
 +
{{#set: produced by=ALLANTOICASE-RXN}}

Latest revision as of 19:18, 21 March 2018

Metabolite CPD-1091

  • smiles:
    • C(O)(C([O-])=O)NC(N)=O
  • common name:
    • S-ureidoglycolate
  • inchi key:
    • InChIKey=NWZYYCVIOKVTII-SFOWXEAESA-M
  • molecular weight:
    • 133.083
  • Synonym(s):
    • (-)-ureidoglycolate
    • ureidoglycolate
    • S-(-)-ureidoglycolate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)(C([O-])=O)NC(N)=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-1091&oldid=40809"