Difference between revisions of "PWY-7295"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14115 CPD-14115] == * smiles: ** C3(C(C1(CC2(=CC=C(C=C(OC1)2)O)))=CC=C(C=3)O) * inchi key:...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7295 PWY-7295] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7295 PWY-7295] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** L-arabinose degradation IV |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''3''' reactions found over '''8''' reactions in the full pathway | |
− | == Reaction(s) | + | * [[GLYCOLATE-REDUCTASE-RXN]] |
− | * [[RXN- | + | ** 2 associated gene(s): |
+ | *** [[Tiso_gene_91]] | ||
+ | *** [[Tiso_gene_777]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | * [[MALSYN-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_14377]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-14809]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=4.1.2.18-RXN 4.1.2.18-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=L-ARABINONATE-DEHYDRATASE-RXN L-ARABINONATE-DEHYDRATASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=L-ARABINONOLACTONASE-RXN L-ARABINONOLACTONASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14642 RXN-14642] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8774 RXN-8774] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | + | {{#set: common name=L-arabinose degradation IV}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: total reaction=8}} | |
− | + | {{#set: completion rate=38.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:19, 21 March 2018
Pathway PWY-7295
- taxonomic range:
- common name:
- L-arabinose degradation IV
- Synonym(s):
Reaction(s) found
3 reactions found over 8 reactions in the full pathway
- GLYCOLATE-REDUCTASE-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- MALSYN-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-14809
- 0 associated gene:
- 1 reconstruction source(s) associated: